Name | 5-[2-(4-hydroxyphenyl)ethyl]-2-methoxyphenol |
Wikidata | Q82766005 |
Mol. formula | C15H16O3 |
CAS registry number | - |
Mol. weight | 244.2863 |
Temporary LOTUS id | LTS0056872 |
Name | 5-[2-(4-hydroxyphenyl)ethyl]-2-methoxyphenol |
Canonical SMILES | COc1ccc(CCc2ccc(O)cc2)cc1O |
2D SMILES | COc1ccc(CCc2ccc(O)cc2)cc1O |
IUPAC name | 5-[2-(4-hydroxyphenyl)ethyl]-2-methoxyphenol |
InChI | InChI=1S/C15H16O3/c1-18-15-9-6-12(10-14(15)17)3-2-11-4-7-13(16)8-5-11/h4-10,16-17H,2-3H2,1H3 |
InChIKey | GUNRICIIRFLJKK-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | c1ccc(cc1)CCc2ccccc2 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Stilbenoids | Monomeric stilbenes |
Total atom number | 34 |
Heavy atom number | 18 |
Bond count | 19 |
Number of carbons | 15 |
Minimal number of rings | 2 |
Maximal number of rings | 2 |
NP-likeness score | 1 |
Alogp | 3.71 |
Alogp2 | 13.76 |
Apol | 39.4747 |
Bpol | 19.4073 |
EccentricConnectivityIndexDescriptor | 343 |
FmfDescriptor | 0.7778 |
Fsp3 | 0.2 |
FragmentComplexityDescriptor | 919.03 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 698 |
Xlogp | 3.203 |
ZagrebIndex | 88 |
TopoPSA | 49.69 |