Name | 5-[(3e)-9-butyl-4-methyl-2,14-dioxa-10-azapentacyclo[6.5.1.0¹,⁵.0⁶,¹⁰.0⁹,¹³]tetradecan-3-ylidene]-4-methoxy-3-methylfuran-2-one |
Wikidata | Q105104478 |
Mol. formula | C22H29NO5 |
CAS registry number | - |
Mol. weight | 387.4702 |
Temporary LOTUS id | LTS0056767 |
Name | 5-[(3e)-9-butyl-4-methyl-2,14-dioxa-10-azapentacyclo[6.5.1.0¹,⁵.0⁶,¹⁰.0⁹,¹³]tetradecan-3-ylidene]-4-methoxy-3-methylfuran-2-one |
Canonical SMILES | CCCCC12C3CC4C5C(C)/C(=C6\OC(=O)C(C)=C6OC)OC5(O3)C1CCN42 |
2D SMILES | CCCCC12C3CC4C5C(C)C(=C6OC(=O)C(C)=C6OC)OC5(O3)C1CCN42 |
IUPAC name | 5-[(3E)-9-butyl-4-methyl-2,14-dioxa-10-azapentacyclo[6.5.1.0¹,⁵.0⁶,¹⁰.0⁹,¹³]tetradecan-3-ylidene]-4-methoxy-3-methyl-2,5-dihydrofuran-2-one |
InChI | InChI=1S/C22H29NO5/c1-5-6-8-21-14-7-9-23(21)13-10-15(21)27-22(14)16(13)11(2)18(28-22)19-17(25-4)12(3)20(24)26-19/h11,13-16H,5-10H2,1-4H3/b19-18+ |
InChIKey | DTVYAHOULQCSMS-VHEBQXMUSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1C(C=CC1)=C2OC34OC5CC(N6CCC3C65)C4C2 |
Pathway | Superclass | Class |
Alkaloids | Ornithine alkaloids | Stemona alkaloids |
Total atom number | 57 |
Heavy atom number | 28 |
Bond count | 33 |
Number of carbons | 22 |
Minimal number of rings | 6 |
Maximal number of rings | 23 |
NP-likeness score | 1.11 |
Alogp | 2.08 |
Alogp2 | 4.33 |
Apol | 63.167 |
Bpol | 42.305 |
EccentricConnectivityIndexDescriptor | 575 |
FmfDescriptor | 0.6786 |
Fsp3 | 0.7727 |
FragmentComplexityDescriptor | 3088.06 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1758 |
Xlogp | 3.423 |
ZagrebIndex | 176 |
TopoPSA | 57.23 |