Name | 18-ethyl-10-(methoxycarbonyl)-8,14-diazapentacyclo[9.5.2.0¹,⁹.0²,⁷.0¹⁴,¹⁷]octadeca-2,4,6,9-tetraen-14-ium-14-olate |
Wikidata | Q82095113 |
Mol. formula | C20H24N2O3 |
CAS registry number | - |
Mol. weight | 340.4169 |
Temporary LOTUS id | LTS0055566 |
Name | 18-ethyl-10-(methoxycarbonyl)-8,14-diazapentacyclo[9.5.2.0¹,⁹.0²,⁷.0¹⁴,¹⁷]octadeca-2,4,6,9-tetraen-14-ium-14-olate |
Canonical SMILES | CCC1C2CC[N+]3([O-])CCC4(C(=C2C(=O)OC)Nc2ccccc24)C13 |
2D SMILES | CCC1C2CC[N+]3([O-])CCC4(C(=C2C(=O)OC)Nc2ccccc24)C13 |
IUPAC name | 18-ethyl-10-(methoxycarbonyl)-8,14-diazapentacyclo[9.5.2.0¹,⁹.0²,⁷.0¹⁴,¹⁷]octadeca-2,4,6,9-tetraen-14-ium-14-olate |
InChI | InChI=1S/C20H24N2O3/c1-3-12-13-8-10-22(24)11-9-20(18(12)22)14-6-4-5-7-15(14)21-17(20)16(13)19(23)25-2/h4-7,12-13,18,21H,3,8-11H2,1-2H3 |
InChIKey | YNCJDBRZKNLHIH-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | c1ccc2c(c1)NC3=CC4CCN5CCC32C5C4 |
Pathway | Superclass | Class |
- | - | - |
Total atom number | 49 |
Heavy atom number | 25 |
Bond count | 29 |
Number of carbons | 20 |
Minimal number of rings | 5 |
Maximal number of rings | 18 |
NP-likeness score | 1.04 |
Alogp | 2.23 |
Alogp2 | 4.99 |
Apol | 55.809 |
Bpol | 32.049 |
EccentricConnectivityIndexDescriptor | 371 |
FmfDescriptor | 0.72 |
Fsp3 | 0.55 |
FragmentComplexityDescriptor | 2209.05 |
PetitjeanNumber | 0.375 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1153 |
Xlogp | 2.843 |
ZagrebIndex | 152 |
TopoPSA | 61.39 |