Name | 5-methoxy-4,6,6-trimethyl-2-(2-methylpropanoyl)cyclohex-4-ene-1,3-dione |
Wikidata | Q104375767 |
Mol. formula | C14H20O4 |
CAS registry number | - |
Mol. weight | 252.3067 |
Temporary LOTUS id | LTS0055412 |
Name | 5-methoxy-4,6,6-trimethyl-2-(2-methylpropanoyl)cyclohex-4-ene-1,3-dione |
Canonical SMILES | COC1=C(C)C(=O)C(C(=O)C(C)C)C(=O)C1(C)C |
2D SMILES | COC1=C(C)C(=O)C(C(=O)C(C)C)C(=O)C1(C)C |
IUPAC name | 5-methoxy-4,6,6-trimethyl-2-(2-methylpropanoyl)cyclohex-4-ene-1,3-dione |
InChI | InChI=1S/C14H20O4/c1-7(2)10(15)9-11(16)8(3)13(18-6)14(4,5)12(9)17/h7,9H,1-6H3 |
InChIKey | WZXQWLWGLWIQGK-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | C1=CCCCC1 |
Pathway | Superclass | Class |
Polyketides | Cyclic polyketides | Simple cyclic polyketides |
Total atom number | 38 |
Heavy atom number | 18 |
Bond count | 18 |
Number of carbons | 14 |
Minimal number of rings | 1 |
Maximal number of rings | 1 |
NP-likeness score | 1.14 |
Alogp | 1.53 |
Alogp2 | 2.35 |
Apol | 41.1839 |
Bpol | 26.6541 |
EccentricConnectivityIndexDescriptor | 204 |
FmfDescriptor | 0.3333 |
Fsp3 | 0.6429 |
FragmentComplexityDescriptor | 1138.04 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 532 |
Xlogp | 0.696 |
ZagrebIndex | 92 |
TopoPSA | 60.44 |