Name | [(1s,5z,9r,10s)-6-[(acetyloxy)methyl]-10-methyl-2-methylidene-7-oxobicyclo[7.2.0]undec-5-en-10-yl]methyl acetate |
Wikidata | Q105248205 |
Mol. formula | C19H26O5 |
CAS registry number | - |
Mol. weight | 334.4075 |
Temporary LOTUS id | LTS0054464 |
Name | [(1s,5z,9r,10s)-6-[(acetyloxy)methyl]-10-methyl-2-methylidene-7-oxobicyclo[7.2.0]undec-5-en-10-yl]methyl acetate |
Canonical SMILES | C=C1CC/C=C(/COC(C)=O)C(=O)C[C@@H]2[C@@H]1C[C@]2(C)COC(C)=O |
2D SMILES | C=C1CCC=C(COC(C)=O)C(=O)CC2C1CC2(C)COC(C)=O |
IUPAC name | [(1S,5Z,9R,10S)-6-[(acetyloxy)methyl]-10-methyl-2-methylidene-7-oxobicyclo[7.2.0]undec-5-en-10-yl]methyl acetate |
InChI | InChI=1S/C19H26O5/c1-12-6-5-7-15(10-23-13(2)20)18(22)8-17-16(12)9-19(17,4)11-24-14(3)21/h7,16-17H,1,5-6,8-11H2,2-4H3/b15-7-/t16-,17-,19-/m1/s1 |
InChIKey | RYXSCMSHMBXDLZ-VORKHOHGSA-N |
Deep SMILES | could not be computed |
Murcko Framework | C1=CCCC2CCC2CCC1 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Caryophyllane sesquiterpenoids |
Total atom number | 50 |
Heavy atom number | 24 |
Bond count | 25 |
Number of carbons | 19 |
Minimal number of rings | 2 |
Maximal number of rings | 3 |
NP-likeness score | 1.03 |
Alogp | 2.19 |
Alogp2 | 4.79 |
Apol | 54.7866 |
Bpol | 35.1294 |
EccentricConnectivityIndexDescriptor | 444 |
FmfDescriptor | 0.4583 |
Fsp3 | 0.6316 |
FragmentComplexityDescriptor | 2049.05 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1348 |
Xlogp | 2.538 |
ZagrebIndex | 122 |
TopoPSA | 69.67 |