Name | 1,5-dihydroxy-2,3,4-trimethoxyxanthen-9-one |
Wikidata | Q105367503 |
Mol. formula | C16H14O7 |
CAS registry number | - |
Mol. weight | 318.2788 |
Temporary LOTUS id | LTS0054013 |
Name | 1,5-dihydroxy-2,3,4-trimethoxyxanthen-9-one |
Canonical SMILES | COc1c(OC)c(O)c2c(=O)c3cccc(O)c3oc2c1OC |
2D SMILES | COc1c(OC)c(O)c2c(=O)c3cccc(O)c3oc2c1OC |
IUPAC name | 1,5-dihydroxy-2,3,4-trimethoxy-9H-xanthen-9-one |
InChI | InChI=1S/C16H14O7/c1-20-14-11(19)9-10(18)7-5-4-6-8(17)12(7)23-13(9)15(21-2)16(14)22-3/h4-6,17,19H,1-3H3 |
InChIKey | YXCUBCSFRXZFSG-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1c2ccccc2Cc3ccccc13 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Xanthones | Plant xanthones |
Total atom number | 37 |
Heavy atom number | 23 |
Bond count | 25 |
Number of carbons | 16 |
Minimal number of rings | 3 |
Maximal number of rings | 6 |
NP-likeness score | 1 |
Alogp | 2.64 |
Alogp2 | 6.94 |
Apol | 43.1091 |
Bpol | 23.9269 |
EccentricConnectivityIndexDescriptor | 351 |
FmfDescriptor | 0.6087 |
Fsp3 | 0.1875 |
FragmentComplexityDescriptor | 1015.07 |
PetitjeanNumber | 0.4444 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1018 |
Xlogp | 2.877 |
ZagrebIndex | 124 |
TopoPSA | 98.36 |