Name | Caffeoylmalic acid |
Wikidata | Q105211546 |
Mol. formula | C13H12O8 |
CAS registry number | - |
Mol. weight | 296.2301 |
Temporary LOTUS id | LTS0053817 |
Name | Caffeoylmalic acid |
Canonical SMILES | O=C(O)CC(OC(=O)C=Cc1ccc(O)c(O)c1)C(=O)O |
2D SMILES | O=C(O)CC(OC(=O)C=Cc1ccc(O)c(O)c1)C(=O)O |
IUPAC name | 2-{[3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy}butanedioic acid |
InChI | InChI=1S/C13H12O8/c14-8-3-1-7(5-9(8)15)2-4-12(18)21-10(13(19)20)6-11(16)17/h1-5,10,14-15H,6H2,(H,16,17)(H,19,20) |
InChIKey | PMKQSEYPLQIEAY-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | c1ccccc1 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Phenylpropanoids (C6-C3) | Cinnamic acids and derivatives |
Total atom number | 33 |
Heavy atom number | 21 |
Bond count | 21 |
Number of carbons | 13 |
Minimal number of rings | 1 |
Maximal number of rings | 1 |
NP-likeness score | 1.58 |
Alogp | 1.02 |
Alogp2 | 1.04 |
Apol | 37.2975 |
Bpol | 17.9085 |
EccentricConnectivityIndexDescriptor | 393 |
FmfDescriptor | 0.2857 |
Fsp3 | 0.1538 |
FragmentComplexityDescriptor | 669.08 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1078 |
Xlogp | 0.604 |
ZagrebIndex | 98 |
TopoPSA | 141.36 |