Name | [(3r,3ar,7as)-3-hydroxy-3-methyl-3a,4,5,7a-tetrahydro-2h-1-benzofuran-6-yl]methyl (2e)-3-(4-hydroxyphenyl)prop-2-enoate |
Wikidata | Q105120861 |
Mol. formula | C19H22O5 |
CAS registry number | - |
Mol. weight | 330.3757 |
Temporary LOTUS id | LTS0053346 |
Name | [(3r,3ar,7as)-3-hydroxy-3-methyl-3a,4,5,7a-tetrahydro-2h-1-benzofuran-6-yl]methyl (2e)-3-(4-hydroxyphenyl)prop-2-enoate |
Canonical SMILES | C[C@]1(O)CO[C@H]2C=C(COC(=O)/C=C/c3ccc(O)cc3)CC[C@H]21 |
2D SMILES | CC1(O)COC2C=C(COC(=O)C=Cc3ccc(O)cc3)CCC21 |
IUPAC name | [(3R,3aR,7aS)-3-hydroxy-3-methyl-2,3,3a,4,5,7a-hexahydro-1-benzofuran-6-yl]methyl (2E)-3-(4-hydroxyphenyl)prop-2-enoate |
InChI | InChI=1S/C19H22O5/c1-19(22)12-24-17-10-14(4-8-16(17)19)11-23-18(21)9-5-13-2-6-15(20)7-3-13/h2-3,5-7,9-10,16-17,20,22H,4,8,11-12H2,1H3/b9-5+/t16-,17+,19+/m1/s1 |
InChIKey | IUVKFRYCDSXZIC-WMQMGCBPSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O(CC=Cc1ccccc1)CC2=CC3OCCC3CC2 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | - |
Total atom number | 46 |
Heavy atom number | 24 |
Bond count | 26 |
Number of carbons | 19 |
Minimal number of rings | 3 |
Maximal number of rings | 4 |
NP-likeness score | 1.28 |
Alogp | 2.35 |
Alogp2 | 5.52 |
Apol | 52.1194 |
Bpol | 28.8406 |
EccentricConnectivityIndexDescriptor | 608 |
FmfDescriptor | 0.8333 |
Fsp3 | 0.4211 |
FragmentComplexityDescriptor | 1752.05 |
PetitjeanNumber | 0.4667 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1623 |
Xlogp | 1.933 |
ZagrebIndex | 126 |
TopoPSA | 75.99 |