Name | 9-(2,3-dihydroxy-3-methylbutoxy)furo[3,2-g]chromen-7-one |
Wikidata | Q27165654 |
Mol. formula | C16H16O6 |
CAS registry number | - |
Mol. weight | 304.2953 |
Temporary LOTUS id | LTS0053323 |
Name | 9-(2,3-dihydroxy-3-methylbutoxy)furo[3,2-g]chromen-7-one |
Canonical SMILES | CC(C)(O)C(O)COc1c2occc2cc2ccc(=O)oc12 |
2D SMILES | CC(C)(O)C(O)COc1c2occc2cc2ccc(=O)oc12 |
IUPAC name | 9-(2,3-dihydroxy-3-methylbutoxy)-7H-furo[3,2-g]chromen-7-one |
InChI | InChI=1S/C16H16O6/c1-16(2,19)11(17)8-21-15-13-10(5-6-20-13)7-9-3-4-12(18)22-14(9)15/h3-7,11,17,19H,8H2,1-2H3 |
InChIKey | FOINLJRVEBYARJ-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | o1ccc2cc3C=CCOc3cc12 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Coumarins | Furocoumarins |
Total atom number | 38 |
Heavy atom number | 22 |
Bond count | 24 |
Number of carbons | 16 |
Minimal number of rings | 3 |
Maximal number of rings | 6 |
NP-likeness score | 1.3 |
Alogp | 1.99 |
Alogp2 | 3.96 |
Apol | 43.6407 |
Bpol | 24.1973 |
EccentricConnectivityIndexDescriptor | 346 |
FmfDescriptor | 0.5909 |
Fsp3 | 0.3125 |
FragmentComplexityDescriptor | 1138.06 |
PetitjeanNumber | 0.4444 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1011 |
Xlogp | 2.104 |
ZagrebIndex | 120 |
TopoPSA | 93.04 |