Name | (2e)-3-(3-methoxyphenyl)-1-(pyrrolidin-1-yl)prop-2-en-1-one |
Wikidata | Q76305665 |
Mol. formula | C14H17NO2 |
CAS registry number | - |
Mol. weight | 231.2908 |
Temporary LOTUS id | LTS0052701 |
Name | (2e)-3-(3-methoxyphenyl)-1-(pyrrolidin-1-yl)prop-2-en-1-one |
Canonical SMILES | COc1cccc(/C=C/C(=O)N2CCCC2)c1 |
2D SMILES | COc1cccc(C=CC(=O)N2CCCC2)c1 |
IUPAC name | (2E)-3-(3-methoxyphenyl)-1-(pyrrolidin-1-yl)prop-2-en-1-one |
InChI | InChI=1S/C14H17NO2/c1-17-13-6-4-5-12(11-13)7-8-14(16)15-9-2-3-10-15/h4-8,11H,2-3,9-10H2,1H3/b8-7+ |
InChIKey | LAPTWLCIZWFMJK-BQYQJAHWSA-N |
Deep SMILES | could not be computed |
Murcko Framework | c1ccc(cc1)C=CCN2CCCC2 |
Pathway | Superclass | Class |
Alkaloids | Lysine alkaloids | Piperidine alkaloids |
Total atom number | 34 |
Heavy atom number | 17 |
Bond count | 18 |
Number of carbons | 14 |
Minimal number of rings | 2 |
Maximal number of rings | 2 |
NP-likeness score | 0.91 |
Alogp | 2.16 |
Alogp2 | 4.65 |
Apol | 38.6795 |
Bpol | 23.4385 |
EccentricConnectivityIndexDescriptor | 283 |
FmfDescriptor | 0.8235 |
Fsp3 | 0.3571 |
FragmentComplexityDescriptor | 953.03 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 585 |
Xlogp | 2.262 |
ZagrebIndex | 82 |
TopoPSA | 29.54 |