Name | 7-methoxy-6-(3-methylbut-2-en-1-yl)-3-(2-methylbut-3-en-2-yl)chromen-2-one |
Wikidata | Q105119957 |
Mol. formula | C20H24O3 |
CAS registry number | - |
Mol. weight | 312.4035 |
Temporary LOTUS id | LTS0049980 |
Name | 7-methoxy-6-(3-methylbut-2-en-1-yl)-3-(2-methylbut-3-en-2-yl)chromen-2-one |
Canonical SMILES | C=CC(C)(C)c1cc2cc(CC=C(C)C)c(OC)cc2oc1=O |
2D SMILES | C=CC(C)(C)c1cc2cc(CC=C(C)C)c(OC)cc2oc1=O |
IUPAC name | 7-methoxy-6-(3-methylbut-2-en-1-yl)-3-(2-methylbut-3-en-2-yl)-2H-chromen-2-one |
InChI | InChI=1S/C20H24O3/c1-7-20(4,5)16-11-15-10-14(9-8-13(2)3)17(22-6)12-18(15)23-19(16)21/h7-8,10-12H,1,9H2,2-6H3 |
InChIKey | ITCYTGAJOJILCW-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1c2ccccc2C=CC1 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Coumarins | Simple coumarins |
Total atom number | 47 |
Heavy atom number | 23 |
Bond count | 24 |
Number of carbons | 20 |
Minimal number of rings | 2 |
Maximal number of rings | 3 |
NP-likeness score | 1 |
Alogp | 5.48 |
Alogp2 | 29.98 |
Apol | 53.609 |
Bpol | 31.027 |
EccentricConnectivityIndexDescriptor | 402 |
FmfDescriptor | 0.4348 |
Fsp3 | 0.35 |
FragmentComplexityDescriptor | 1798.03 |
PetitjeanNumber | 0.4545 |
LipinskiRuleOf5Failures | 1 |
WienerPathNumber | 1186 |
Xlogp | 6.661 |
ZagrebIndex | 118 |
TopoPSA | 39.44 |