Name | Brosimacutin e |
Wikidata | Q105308123 |
Mol. formula | C20H20O5 |
CAS registry number | - |
Mol. weight | 340.3706 |
Temporary LOTUS id | LTS0049469 |
Name | Brosimacutin e |
Canonical SMILES | CC(C)(O)C1Cc2c(ccc3c2O[C@H](c2ccc(O)cc2)CC3=O)O1 |
2D SMILES | CC(C)(O)C1Cc2c(ccc3c2OC(c2ccc(O)cc2)CC3=O)O1 |
IUPAC name | (12S)-12-(4-hydroxyphenyl)-4-(2-hydroxypropan-2-yl)-5,13-dioxatricyclo[7.4.0.0²,⁶]trideca-1(9),2(6),7-trien-10-one |
InChI | InChI=1S/C20H20O5/c1-20(2,23)18-9-14-16(24-18)8-7-13-15(22)10-17(25-19(13)14)11-3-5-12(21)6-4-11/h3-8,17-18,21,23H,9-10H2,1-2H3/t17-,18?/m0/s1 |
InChIKey | WLOCVXKIOFOGBF-ZENAZSQFSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1c2ccc3c(OC(c4ccccc4)CC3)c2CC1 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Flavonoids | Flavanones |
Total atom number | 45 |
Heavy atom number | 25 |
Bond count | 28 |
Number of carbons | 20 |
Minimal number of rings | 4 |
Maximal number of rings | 7 |
NP-likeness score | 1.28 |
Alogp | 2.96 |
Alogp2 | 8.78 |
Apol | 52.5459 |
Bpol | 26.6541 |
EccentricConnectivityIndexDescriptor | 505 |
FmfDescriptor | 0.76 |
Fsp3 | 0.35 |
FragmentComplexityDescriptor | 1704.05 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1441 |
Xlogp | 2.807 |
ZagrebIndex | 142 |
TopoPSA | 75.99 |