Name | (1s,4ar,5s,8ar)-5-(3-carboxy-3-methylprop-2-en-1-yl)-1,4a-dimethyl-6-methylidene-hexahydro-2h-naphthalene-1-carboxylic acid |
Wikidata | Q105136577 |
Mol. formula | C19H28O4 |
CAS registry number | - |
Mol. weight | 320.4239 |
Temporary LOTUS id | LTS0048384 |
Name | (1s,4ar,5s,8ar)-5-(3-carboxy-3-methylprop-2-en-1-yl)-1,4a-dimethyl-6-methylidene-hexahydro-2h-naphthalene-1-carboxylic acid |
Canonical SMILES | C=C1CC[C@H]2[C@@](C)(C(=O)O)CCC[C@]2(C)[C@H]1CC=C(C)C(=O)O |
2D SMILES | C=C1CCC2C(C)(C(=O)O)CCCC2(C)C1CC=C(C)C(=O)O |
IUPAC name | (1S,4aR,5S,8aR)-5-(3-carboxy-3-methylprop-2-en-1-yl)-1,4a-dimethyl-6-methylidene-decahydronaphthalene-1-carboxylic acid |
InChI | InChI=1S/C19H28O4/c1-12-7-9-15-18(3,10-5-11-19(15,4)17(22)23)14(12)8-6-13(2)16(20)21/h6,14-15H,1,5,7-11H2,2-4H3,(H,20,21)(H,22,23)/t14-,15+,18+,19-/m0/s1 |
InChIKey | JXHQWTYFUSHCGX-SFUIVIKGSA-N |
Deep SMILES | could not be computed |
Murcko Framework | C1CCC2CCCCC2C1 |
Pathway | Superclass | Class |
Terpenoids|Terpenoids | Diterpenoids|Diterpenoids | Labdane diterpenoids|Norlabdane diterpenoids |
Total atom number | 51 |
Heavy atom number | 23 |
Bond count | 24 |
Number of carbons | 19 |
Minimal number of rings | 2 |
Maximal number of rings | 3 |
NP-likeness score | 1.71 |
Alogp | 4.36 |
Alogp2 | 19.01 |
Apol | 55.3182 |
Bpol | 32.5258 |
EccentricConnectivityIndexDescriptor | 364 |
FmfDescriptor | 0.4348 |
Fsp3 | 0.6842 |
FragmentComplexityDescriptor | 2198.04 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1106 |
Xlogp | 4.452 |
ZagrebIndex | 122 |
TopoPSA | 74.6 |