Name | 1,6-dimethyl-1h,2h,8h,9h-phenanthro[1,2-b]furan-10,11-dione |
Wikidata | Q82900179 |
Mol. formula | C18H16O3 |
CAS registry number | - |
Mol. weight | 280.3185 |
Temporary LOTUS id | LTS0048181 |
Name | 1,6-dimethyl-1h,2h,8h,9h-phenanthro[1,2-b]furan-10,11-dione |
Canonical SMILES | CC1=CCCc2c1ccc1c2C(=O)C(=O)C2=C1OCC2C |
2D SMILES | CC1=CCCc2c1ccc1c2C(=O)C(=O)C2=C1OCC2C |
IUPAC name | 1,6-dimethyl-1H,2H,8H,9H,10H,11H-phenanthro[1,2-b]furan-10,11-dione |
InChI | InChI=1S/C18H16O3/c1-9-4-3-5-12-11(9)6-7-13-15(12)17(20)16(19)14-10(2)8-21-18(13)14/h4,6-7,10H,3,5,8H2,1-2H3 |
InChIKey | AZIUYJPOBCMPON-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1C=2c3ccc4C=CCCc4c3CCC2CC1 |
Pathway | Superclass | Class |
Polyketides | Naphthalenes | Naphthoquinones |
Total atom number | 37 |
Heavy atom number | 21 |
Bond count | 24 |
Number of carbons | 18 |
Minimal number of rings | 4 |
Maximal number of rings | 10 |
NP-likeness score | 1.25 |
Alogp | 2.98 |
Alogp2 | 8.87 |
Apol | 44.7547 |
Bpol | 21.3233 |
EccentricConnectivityIndexDescriptor | 320 |
FmfDescriptor | 0.8095 |
Fsp3 | 0.3333 |
FragmentComplexityDescriptor | 1180.03 |
PetitjeanNumber | 0.4444 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 789 |
Xlogp | 3.514 |
ZagrebIndex | 122 |
TopoPSA | 43.37 |