Name | 2-[(1r,2s)-1,2-dimethyl-3-methylidenecyclopentyl]-5-methylphenol |
Wikidata | Q82276918 |
Mol. formula | C15H20O |
CAS registry number | - |
Mol. weight | 216.3193 |
Temporary LOTUS id | LTS0047318 |
Name | 2-[(1r,2s)-1,2-dimethyl-3-methylidenecyclopentyl]-5-methylphenol |
Canonical SMILES | C=C1CC[C@@](C)(c2ccc(C)cc2O)[C@H]1C |
2D SMILES | C=C1CCC(C)(c2ccc(C)cc2O)C1C |
IUPAC name | 2-[(1R,2S)-1,2-dimethyl-3-methylidenecyclopentyl]-5-methylphenol |
InChI | InChI=1S/C15H20O/c1-10-5-6-13(14(16)9-10)15(4)8-7-11(2)12(15)3/h5-6,9,12,16H,2,7-8H2,1,3-4H3/t12-,15+/m0/s1 |
InChIKey | TWNGKYVFHDFBJI-SWLSCSKDSA-N |
Deep SMILES | could not be computed |
Murcko Framework | c1ccc(cc1)C2CCCC2 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Laurane sesquiterpenoids |
Total atom number | 36 |
Heavy atom number | 16 |
Bond count | 17 |
Number of carbons | 15 |
Minimal number of rings | 2 |
Maximal number of rings | 2 |
NP-likeness score | 1 |
Alogp | 4.3 |
Alogp2 | 18.47 |
Apol | 40.5379 |
Bpol | 21.8641 |
EccentricConnectivityIndexDescriptor | 202 |
FmfDescriptor | 0.6875 |
Fsp3 | 0.4667 |
FragmentComplexityDescriptor | 1129.01 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 399 |
Xlogp | 4.552 |
ZagrebIndex | 86 |
TopoPSA | 20.23 |