Name | 2-{[2-(4a-methyl-8-methylidene-octahydronaphthalen-2-yl)propan-2-yl]oxy}oxane-3,4,5-triol |
Wikidata | Q105134683 |
Mol. formula | C20H34O5 |
CAS registry number | - |
Mol. weight | 354.4817 |
Temporary LOTUS id | LTS0046948 |
Name | 2-{[2-(4a-methyl-8-methylidene-octahydronaphthalen-2-yl)propan-2-yl]oxy}oxane-3,4,5-triol |
Canonical SMILES | C=C1CCCC2(C)CCC(C(C)(C)OC3OCC(O)C(O)C3O)CC12 |
2D SMILES | C=C1CCCC2(C)CCC(C(C)(C)OC3OCC(O)C(O)C3O)CC12 |
IUPAC name | 2-{[2-(4a-methyl-8-methylidene-decahydronaphthalen-2-yl)propan-2-yl]oxy}oxane-3,4,5-triol |
InChI | InChI=1S/C20H34O5/c1-12-6-5-8-20(4)9-7-13(10-14(12)20)19(2,3)25-18-17(23)16(22)15(21)11-24-18/h13-18,21-23H,1,5-11H2,2-4H3 |
InChIKey | JTAFQMVMOSJGMB-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | C1CCC2CCCCC2C1 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Eudesmane sesquiterpenoids |
Total atom number | 59 |
Heavy atom number | 25 |
Bond count | 27 |
Number of carbons | 20 |
Minimal number of rings | 3 |
Maximal number of rings | 4 |
NP-likeness score | 1.41 |
Alogp | 2.48 |
Alogp2 | 6.17 |
Apol | 61.881 |
Bpol | 41.001 |
EccentricConnectivityIndexDescriptor | 495 |
FmfDescriptor | 0.72 |
Fsp3 | 0.9 |
FragmentComplexityDescriptor | 3121.05 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1468 |
Xlogp | 3.965 |
ZagrebIndex | 138 |
TopoPSA | 79.15 |