Name | 3,4,5',6',9,10'-hexamethoxy-[1,1'-biphenanthrene]-2,2',7,7'-tetrol |
Wikidata | Q104992203 |
Mol. formula | C34H30O10 |
CAS registry number | - |
Mol. weight | 598.5973 |
Temporary LOTUS id | LTS0046654 |
Name | 3,4,5',6',9,10'-hexamethoxy-[1,1'-biphenanthrene]-2,2',7,7'-tetrol |
Canonical SMILES | COc1c(O)cc2cc(OC)c3c(-c4c(O)c(OC)c(OC)c5c4cc(OC)c4cc(O)ccc45)c(O)ccc3c2c1OC |
2D SMILES | COc1c(O)cc2cc(OC)c3c(-c4c(O)c(OC)c(OC)c5c4cc(OC)c4cc(O)ccc45)c(O)ccc3c2c1OC |
IUPAC name | 3,4,5',6',9,10'-hexamethoxy-[1,1'-biphenanthrene]-2,2',7,7'-tetrol |
InChI | InChI=1S/C34H30O10/c1-39-23-14-20-26(17-8-7-16(35)13-19(17)23)33(43-5)34(44-6)30(38)28(20)29-21(36)10-9-18-25-15(12-24(40-2)27(18)29)11-22(37)31(41-3)32(25)42-4/h7-14,35-38H,1-6H3 |
InChIKey | FAEKSGIHDACYAU-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | c1ccc2c(c1)ccc3c2cccc3-c4cccc5c6ccccc6ccc54 |
Pathway | Superclass | Class |
Polyketides|Shikimates and Phenylpropanoids | Naphthalenes|Phenanthrenoids | |Phenanthrenes |
Total atom number | 74 |
Heavy atom number | 44 |
Bond count | 49 |
Number of carbons | 34 |
Minimal number of rings | 6 |
Maximal number of rings | 12 |
NP-likeness score | 1 |
Alogp | 5.81 |
Alogp2 | 33.8 |
Apol | 87.8638 |
Bpol | 44.2922 |
EccentricConnectivityIndexDescriptor | 1100 |
FmfDescriptor | 0.6364 |
Fsp3 | 0.1765 |
FragmentComplexityDescriptor | 4349.1 |
PetitjeanNumber | 0.4667 |
LipinskiRuleOf5Failures | 2 |
WienerPathNumber | 5758 |
Xlogp | 6.624 |
ZagrebIndex | 246 |
TopoPSA | 136.3 |