Name | (4br,10ar)-8-hydroxy-7,9-dimethoxy-11,11-dimethyl-4bh,10h,10ah-benzo[b]fluoren-5-one |
Wikidata | Q105328487 |
Mol. formula | C21H22O4 |
CAS registry number | - |
Mol. weight | 338.3978 |
Temporary LOTUS id | LTS0046374 |
Name | (4br,10ar)-8-hydroxy-7,9-dimethoxy-11,11-dimethyl-4bh,10h,10ah-benzo[b]fluoren-5-one |
Canonical SMILES | COc1cc2c(c(OC)c1O)C[C@@H]1[C@@H](C2=O)c2ccccc2C1(C)C |
2D SMILES | COc1cc2c(c(OC)c1O)CC1C(C2=O)c2ccccc2C1(C)C |
IUPAC name | (4bR,10aR)-8-hydroxy-7,9-dimethoxy-11,11-dimethyl-4bH,5H,10H,10aH,11H-benzo[b]fluoren-5-one |
InChI | InChI=1S/C21H22O4/c1-21(2)14-8-6-5-7-11(14)17-15(21)9-13-12(18(17)22)10-16(24-3)19(23)20(13)25-4/h5-8,10,15,17,23H,9H2,1-4H3/t15-,17+/m1/s1 |
InChIKey | XIHRWFBCNJIXNK-WBVHZDCISA-N |
Deep SMILES | could not be computed |
Murcko Framework | c1ccc2c(c1)CC3c4ccccc4CC3C2 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Stilbenoids | Monomeric stilbenes |
Total atom number | 47 |
Heavy atom number | 25 |
Bond count | 28 |
Number of carbons | 21 |
Minimal number of rings | 4 |
Maximal number of rings | 10 |
NP-likeness score | 1.02 |
Alogp | 3.91 |
Alogp2 | 15.32 |
Apol | 54.8374 |
Bpol | 28.8406 |
EccentricConnectivityIndexDescriptor | 420 |
FmfDescriptor | 0.68 |
Fsp3 | 0.381 |
FragmentComplexityDescriptor | 1900.04 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1270 |
Xlogp | 3.426 |
ZagrebIndex | 144 |
TopoPSA | 55.76 |