Name | (1s,4ar,5s,6r,8ar)-5-[(3r)-3-hydroxy-3-methylpent-4-en-1-yl]-1,5,6,8a-tetramethyl-hexahydro-1h-naphthalen-2-one |
Wikidata | Q105245983 |
Mol. formula | C20H34O2 |
CAS registry number | - |
Mol. weight | 306.4835 |
Temporary LOTUS id | LTS0046306 |
Name | (1s,4ar,5s,6r,8ar)-5-[(3r)-3-hydroxy-3-methylpent-4-en-1-yl]-1,5,6,8a-tetramethyl-hexahydro-1h-naphthalen-2-one |
Canonical SMILES | C=C[C@](C)(O)CC[C@@]1(C)[C@H](C)CC[C@@]2(C)[C@H](C)C(=O)CC[C@H]12 |
2D SMILES | C=CC(C)(O)CCC1(C)C(C)CCC2(C)C(C)C(=O)CCC12 |
IUPAC name | (1S,4aR,5S,6R,8aR)-5-[(3R)-3-hydroxy-3-methylpent-4-en-1-yl]-1,5,6,8a-tetramethyl-decahydronaphthalen-2-one |
InChI | InChI=1S/C20H34O2/c1-7-18(4,22)12-13-19(5)14(2)10-11-20(6)15(3)16(21)8-9-17(19)20/h7,14-15,17,22H,1,8-13H2,2-6H3/t14-,15-,17-,18+,19+,20+/m1/s1 |
InChIKey | RVEJNTZMTMKGPW-XVMGYKCHSA-N |
Deep SMILES | could not be computed |
Murcko Framework | C1CCC2CCCCC2C1 |
Pathway | Superclass | Class |
Terpenoids | Diterpenoids | Colensane and Clerodane diterpenoids |
Total atom number | 56 |
Heavy atom number | 22 |
Bond count | 23 |
Number of carbons | 20 |
Minimal number of rings | 2 |
Maximal number of rings | 3 |
NP-likeness score | 1.32 |
Alogp | 4.13 |
Alogp2 | 17.09 |
Apol | 59.475 |
Bpol | 38.127 |
EccentricConnectivityIndexDescriptor | 339 |
FmfDescriptor | 0.4545 |
Fsp3 | 0.85 |
FragmentComplexityDescriptor | 2787.02 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 1 |
WienerPathNumber | 955 |
Xlogp | 5.456 |
ZagrebIndex | 120 |
TopoPSA | 37.3 |