Name | 4-o-sinapoylquinic acid |
Wikidata | Q27105045 |
Mol. formula | C18H22O10 |
CAS registry number | - |
Mol. weight | 398.362 |
Temporary LOTUS id | LTS0045601 |
Name | 4-o-sinapoylquinic acid |
Canonical SMILES | COc1cc(/C=C/C(=O)O[C@H]2[C@H](O)C[C@](O)(C(=O)O)C[C@H]2O)cc(OC)c1O |
2D SMILES | COc1cc(C=CC(=O)OC2C(O)CC(O)(C(=O)O)CC2O)cc(OC)c1O |
IUPAC name | (1S,3R,4S,5R)-1,3,5-trihydroxy-4-{[(2E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]oxy}cyclohexane-1-carboxylic acid |
InChI | InChI=1S/C18H22O10/c1-26-12-5-9(6-13(27-2)15(12)22)3-4-14(21)28-16-10(19)7-18(25,17(23)24)8-11(16)20/h3-6,10-11,16,19-20,22,25H,7-8H2,1-2H3,(H,23,24)/b4-3+/t10-,11-,16-,18+/m1/s1 |
InChIKey | WKRKXTOYTASIOP-RKTLJHTASA-N |
Deep SMILES | could not be computed |
Murcko Framework | O(CC=Cc1ccccc1)C2CCCCC2 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Phenylpropanoids (C6-C3) | Cinnamic acids and derivatives |
Total atom number | 50 |
Heavy atom number | 28 |
Bond count | 29 |
Number of carbons | 18 |
Minimal number of rings | 2 |
Maximal number of rings | 2 |
NP-likeness score | 1.45 |
Alogp | -0.18 |
Alogp2 | 0.03 |
Apol | 54.3694 |
Bpol | 31.7146 |
EccentricConnectivityIndexDescriptor | 639 |
FmfDescriptor | 0.5714 |
Fsp3 | 0.4444 |
FragmentComplexityDescriptor | 1845.1 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 2274 |
Xlogp | -0.952 |
ZagrebIndex | 142 |
TopoPSA | 162.98 |