Name | 2,20-dihydroxy-5-methyl-13-methylidene-7,9-dioxahexacyclo[8.7.2.1¹¹,¹⁴.0¹,⁸.0⁵,¹⁸.0¹¹,¹⁷]icosan-12-one |
Wikidata | Q105168746 |
Mol. formula | C20H26O5 |
CAS registry number | - |
Mol. weight | 346.4182 |
Temporary LOTUS id | LTS0044440 |
Name | 2,20-dihydroxy-5-methyl-13-methylidene-7,9-dioxahexacyclo[8.7.2.1¹¹,¹⁴.0¹,⁸.0⁵,¹⁸.0¹¹,¹⁷]icosan-12-one |
Canonical SMILES | C=C1C(=O)C23C4CC5C6(C)CCC(O)C5(C(OC6)O4)C2CCC1C3O |
2D SMILES | C=C1C(=O)C23C4CC5C6(C)CCC(O)C5(C(OC6)O4)C2CCC1C3O |
IUPAC name | 2,20-dihydroxy-5-methyl-13-methylidene-7,9-dioxahexacyclo[8.7.2.1¹¹,¹⁴.0¹,⁸.0⁵,¹⁸.0¹¹,¹⁷]icosan-12-one |
InChI | InChI=1S/C20H26O5/c1-9-10-3-4-11-19-12-7-14(20(11,15(9)22)16(10)23)25-17(19)24-8-18(12,2)6-5-13(19)21/h10-14,16-17,21,23H,1,3-8H2,2H3 |
InChIKey | MOBGVVQDJSDAER-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1CC2CCCC34C1OC(CC23)C56CCC(CCC54)C6 |
Pathway | Superclass | Class |
Terpenoids | Diterpenoids | Kaurane and Phyllocladane diterpenoids |
Total atom number | 51 |
Heavy atom number | 25 |
Bond count | 30 |
Number of carbons | 20 |
Minimal number of rings | 6 |
Maximal number of rings | 28 |
NP-likeness score | 1.07 |
Alogp | 0.69 |
Alogp2 | 0.47 |
Apol | 56.5466 |
Bpol | 33.2134 |
EccentricConnectivityIndexDescriptor | 366 |
FmfDescriptor | 0.8 |
Fsp3 | 0.85 |
FragmentComplexityDescriptor | 2536.05 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1092 |
Xlogp | 0.356 |
ZagrebIndex | 166 |
TopoPSA | 75.99 |