Name | 2-(2-hydroxy-4-methylphenyl)propyl 3-phenylprop-2-enoate |
Wikidata | Q105029705 |
Mol. formula | C19H20O3 |
CAS registry number | - |
Mol. weight | 296.361 |
Temporary LOTUS id | LTS0042474 |
Name | 2-(2-hydroxy-4-methylphenyl)propyl 3-phenylprop-2-enoate |
Canonical SMILES | Cc1ccc(C(C)COC(=O)C=Cc2ccccc2)c(O)c1 |
2D SMILES | Cc1ccc(C(C)COC(=O)C=Cc2ccccc2)c(O)c1 |
IUPAC name | 2-(2-hydroxy-4-methylphenyl)propyl 3-phenylprop-2-enoate |
InChI | InChI=1S/C19H20O3/c1-14-8-10-17(18(20)12-14)15(2)13-22-19(21)11-9-16-6-4-3-5-7-16/h3-12,15,20H,13H2,1-2H3 |
InChIKey | HKJXKYNIUODVLN-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O(CC=Cc1ccccc1)CCc2ccccc2 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Phenylpropanoids (C6-C3) | Cinnamic acids and derivatives |
Total atom number | 42 |
Heavy atom number | 22 |
Bond count | 23 |
Number of carbons | 19 |
Minimal number of rings | 2 |
Maximal number of rings | 2 |
NP-likeness score | 1.01 |
Alogp | 4.6 |
Alogp2 | 21.12 |
Apol | 49.1819 |
Bpol | 24.7381 |
EccentricConnectivityIndexDescriptor | 497 |
FmfDescriptor | 0.8182 |
Fsp3 | 0.2105 |
FragmentComplexityDescriptor | 1387.03 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1270 |
Xlogp | 4.422 |
ZagrebIndex | 106 |
TopoPSA | 46.53 |