Name | 9-(furan-3-yl)-2,6-dimethylnon-6-en-4-one |
Wikidata | Q82758227 |
Mol. formula | C15H22O2 |
CAS registry number | - |
Mol. weight | 234.3345 |
Temporary LOTUS id | LTS0042110 |
Name | 9-(furan-3-yl)-2,6-dimethylnon-6-en-4-one |
Canonical SMILES | CC(=CCCc1ccoc1)CC(=O)CC(C)C |
2D SMILES | CC(=CCCc1ccoc1)CC(=O)CC(C)C |
IUPAC name | 9-(furan-3-yl)-2,6-dimethylnon-6-en-4-one |
InChI | InChI=1S/C15H22O2/c1-12(2)9-15(16)10-13(3)5-4-6-14-7-8-17-11-14/h5,7-8,11-12H,4,6,9-10H2,1-3H3 |
InChIKey | ILWBIDIEAHLKTC-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | o1cccc1 |
Pathway | Superclass | Class |
Terpenoids|Terpenoids | Sesterterpenoids|Sesquiterpenoids | Norsesterterpenoids| |
Total atom number | 39 |
Heavy atom number | 17 |
Bond count | 17 |
Number of carbons | 15 |
Minimal number of rings | 1 |
Maximal number of rings | 1 |
NP-likeness score | 1.03 |
Alogp | 3.76 |
Alogp2 | 14.14 |
Apol | 42.6734 |
Bpol | 26.9246 |
EccentricConnectivityIndexDescriptor | 295 |
FmfDescriptor | 0.2941 |
Fsp3 | 0.5333 |
FragmentComplexityDescriptor | 1249.02 |
PetitjeanNumber | 0.4545 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 649 |
Xlogp | 3.086 |
ZagrebIndex | 76 |
TopoPSA | 30.21 |