Name | 6-{7-hydroxy-3a,6,6,9a,11a-pentamethyl-1h,2h,3h,4h,5h,5ah,7h,8h,9h,10h,11h-cyclopenta[a]phenanthren-1-yl}-2-methylhept-2-enoic acid |
Wikidata | Q104170259 |
Mol. formula | C30H48O3 |
CAS registry number | - |
Mol. weight | 456.7014 |
Temporary LOTUS id | LTS0041960 |
Name | 6-{7-hydroxy-3a,6,6,9a,11a-pentamethyl-1h,2h,3h,4h,5h,5ah,7h,8h,9h,10h,11h-cyclopenta[a]phenanthren-1-yl}-2-methylhept-2-enoic acid |
Canonical SMILES | CC(=CCCC(C)C1CCC2(C)C3=C(CCC12C)C1(C)CCC(O)C(C)(C)C1CC3)C(=O)O |
2D SMILES | CC(=CCCC(C)C1CCC2(C)C3=C(CCC12C)C1(C)CCC(O)C(C)(C)C1CC3)C(=O)O |
IUPAC name | 6-{7-hydroxy-3a,6,6,9a,11a-pentamethyl-1H,2H,3H,3aH,4H,5H,5aH,6H,7H,8H,9H,9aH,10H,11H,11aH-cyclopenta[a]phenanthren-1-yl}-2-methylhept-2-enoic acid |
InChI | InChI=1S/C30H48O3/c1-19(9-8-10-20(2)26(32)33)21-13-17-30(7)23-11-12-24-27(3,4)25(31)15-16-28(24,5)22(23)14-18-29(21,30)6/h10,19,21,24-25,31H,8-9,11-18H2,1-7H3,(H,32,33) |
InChIKey | KGELVXQPIUKGCO-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | C12=C(CCC3CCCCC13)C4CCCC4CC2 |
Pathway | Superclass | Class |
Terpenoids | Triterpenoids | Lanostane, Tirucallane and Euphane triterpenoids |
Total atom number | 81 |
Heavy atom number | 33 |
Bond count | 36 |
Number of carbons | 30 |
Minimal number of rings | 4 |
Maximal number of rings | 10 |
NP-likeness score | 1.31 |
Alogp | 7.24 |
Alogp2 | 52.39 |
Apol | 87.2121 |
Bpol | 53.4319 |
EccentricConnectivityIndexDescriptor | 845 |
FmfDescriptor | 0.5152 |
Fsp3 | 0.8333 |
FragmentComplexityDescriptor | 6000.03 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 1 |
WienerPathNumber | 3132 |
Xlogp | 8.755 |
ZagrebIndex | 190 |
TopoPSA | 57.53 |