Name | 6,9-dihydroxy-7,7,17-trimethyl-3,10-dioxapentacyclo[14.2.1.0¹,¹³.0⁴,¹².0⁸,¹²]nonadecane-2,18-dione |
Wikidata | Q82906974 |
Mol. formula | C20H28O6 |
CAS registry number | - |
Mol. weight | 364.4335 |
Temporary LOTUS id | LTS0041920 |
Name | 6,9-dihydroxy-7,7,17-trimethyl-3,10-dioxapentacyclo[14.2.1.0¹,¹³.0⁴,¹².0⁸,¹²]nonadecane-2,18-dione |
Canonical SMILES | CC1C(=O)C23CC1CCC2C12COC(O)C1C(C)(C)C(O)CC2OC3=O |
2D SMILES | CC1C(=O)C23CC1CCC2C12COC(O)C1C(C)(C)C(O)CC2OC3=O |
IUPAC name | 6,9-dihydroxy-7,7,17-trimethyl-3,10-dioxapentacyclo[14.2.1.0¹,¹³.0⁴,¹².0⁸,¹²]nonadecane-2,18-dione |
InChI | InChI=1S/C20H28O6/c1-9-10-4-5-11-19(7-10,15(9)22)17(24)26-13-6-12(21)18(2,3)14-16(23)25-8-20(11,13)14/h9-14,16,21,23H,4-8H2,1-3H3 |
InChIKey | XDIFXKVLMXAILB-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1CC2CCCC3OCC45CCC(CCC4C32C1)C5 |
Pathway | Superclass | Class |
Terpenoids | Diterpenoids | Secokaurane diterpenoids |
Total atom number | 54 |
Heavy atom number | 26 |
Bond count | 30 |
Number of carbons | 20 |
Minimal number of rings | 5 |
Maximal number of rings | 15 |
NP-likeness score | 1.09 |
Alogp | 0.72 |
Alogp2 | 0.51 |
Apol | 58.6822 |
Bpol | 36.3578 |
EccentricConnectivityIndexDescriptor | 402 |
FmfDescriptor | 0.7308 |
Fsp3 | 0.9 |
FragmentComplexityDescriptor | 2714.06 |
PetitjeanNumber | 0.4444 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1261 |
Xlogp | 1.302 |
ZagrebIndex | 164 |
TopoPSA | 93.06 |