Name | 2-methoxy-9,10-anthracenedione |
Wikidata | Q83057685 |
Mol. formula | C15H10O3 |
CAS registry number | - |
Mol. weight | 238.2387 |
Temporary LOTUS id | LTS0041778 |
Name | 2-methoxy-9,10-anthracenedione |
Canonical SMILES | COc1ccc2c(c1)C(=O)c1ccccc1C2=O |
2D SMILES | COc1ccc2c(c1)C(=O)c1ccccc1C2=O |
IUPAC name | 2-methoxy-9,10-dihydroanthracene-9,10-dione |
InChI | InChI=1S/C15H10O3/c1-18-9-6-7-12-13(8-9)15(17)11-5-3-2-4-10(11)14(12)16/h2-8H,1H3 |
InChIKey | APLQXUAECQNQFE-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | c1ccc2c(c1)Cc3ccccc3C2 |
Pathway | Superclass | Class |
Polyketides | Polycyclic aromatic polyketides | Anthraquinones and anthrones |
Total atom number | 28 |
Heavy atom number | 18 |
Bond count | 20 |
Number of carbons | 15 |
Minimal number of rings | 3 |
Maximal number of rings | 6 |
NP-likeness score | 1.05 |
Alogp | 2.79 |
Alogp2 | 7.8 |
Apol | 35.4739 |
Bpol | 14.7641 |
EccentricConnectivityIndexDescriptor | 263 |
FmfDescriptor | 0.7778 |
Fsp3 | 0.0667 |
FragmentComplexityDescriptor | 594.03 |
PetitjeanNumber | 0.4444 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 543 |
Xlogp | 3.023 |
ZagrebIndex | 98 |
TopoPSA | 43.37 |