Name | (2r,3r,5r)-5-[(1s,3e)-1-bromohex-3-en-1-yl]-2-[(2e)-pent-2-en-4-yn-1-yl]oxolan-3-yl acetate |
Wikidata | Q104946070 |
Mol. formula | C17H23BrO3 |
CAS registry number | - |
Mol. weight | 355.2669 |
Temporary LOTUS id | LTS0039688 |
Name | (2r,3r,5r)-5-[(1s,3e)-1-bromohex-3-en-1-yl]-2-[(2e)-pent-2-en-4-yn-1-yl]oxolan-3-yl acetate |
Canonical SMILES | C#C/C=C/C[C@H]1O[C@@H]([C@@H](Br)C/C=C/CC)C[C@H]1OC(C)=O |
2D SMILES | C#CC=CCC1OC(C(Br)CC=CCC)CC1OC(C)=O |
IUPAC name | (2R,3R,5R)-5-[(1S,3E)-1-bromohex-3-en-1-yl]-2-[(2E)-pent-2-en-4-yn-1-yl]oxolan-3-yl acetate |
InChI | InChI=1S/C17H23BrO3/c1-4-6-8-10-14(18)16-12-17(20-13(3)19)15(21-16)11-9-7-5-2/h2,6-9,14-17H,4,10-12H2,1,3H3/b8-6+,9-7+/t14-,15+,16+,17+/m0/s1 |
InChIKey | BUFQJMZKMZGEFE-GIGMYMNUSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1CCCC1 |
Pathway | Superclass | Class |
Fatty acids|Fatty acids | Fatty acyls|Fatty acyls | Fatty alcohols|Halogenated hydrocarbons |
Total atom number | 44 |
Heavy atom number | 21 |
Bond count | 21 |
Number of carbons | 17 |
Minimal number of rings | 1 |
Maximal number of rings | 1 |
NP-likeness score | 1.01 |
Alogp | 4.47 |
Alogp2 | 20.01 |
Apol | 50.7122 |
Bpol | 31.2238 |
EccentricConnectivityIndexDescriptor | 394 |
FmfDescriptor | 0.2381 |
Fsp3 | 0.5882 |
FragmentComplexityDescriptor | 1516.04 |
PetitjeanNumber | 0.4615 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1057 |
Xlogp | 4.498 |
ZagrebIndex | 94 |
TopoPSA | 35.53 |