Name | (1s,2r,3r,5r,9r,10r,11s)-10-hydroxy-5,9-dimethyl-14-methylidene-13-oxo-4,12-dioxatricyclo[9.3.0.0³,⁵]tetradecan-2-yl 3-methylbut-2-enoate |
Wikidata | Q105275559 |
Mol. formula | C20H28O6 |
CAS registry number | - |
Mol. weight | 364.4335 |
Temporary LOTUS id | LTS0036516 |
Name | (1s,2r,3r,5r,9r,10r,11s)-10-hydroxy-5,9-dimethyl-14-methylidene-13-oxo-4,12-dioxatricyclo[9.3.0.0³,⁵]tetradecan-2-yl 3-methylbut-2-enoate |
Canonical SMILES | C=C1C(=O)O[C@H]2[C@H]1[C@@H](OC(=O)C=C(C)C)[C@H]1O[C@]1(C)CCC[C@@H](C)[C@H]2O |
2D SMILES | C=C1C(=O)OC2C(O)C(C)CCCC3(C)OC3C(OC(=O)C=C(C)C)C12 |
IUPAC name | (1S,2R,3R,5R,9R,10R,11S)-10-hydroxy-5,9-dimethyl-14-methylidene-13-oxo-4,12-dioxatricyclo[9.3.0.0³,⁵]tetradecan-2-yl 3-methylbut-2-enoate |
InChI | InChI=1S/C20H28O6/c1-10(2)9-13(21)24-17-14-12(4)19(23)25-16(14)15(22)11(3)7-6-8-20(5)18(17)26-20/h9,11,14-18,22H,4,6-8H2,1-3,5H3/t11-,14+,15-,16+,17-,18-,20-/m1/s1 |
InChIKey | UMHQHFHQQZZQGN-LKEAYODTSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1CCC2CC3OC3CCCCCC12 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Germacrane sesquiterpenoids |
Total atom number | 54 |
Heavy atom number | 26 |
Bond count | 28 |
Number of carbons | 20 |
Minimal number of rings | 3 |
Maximal number of rings | 6 |
NP-likeness score | 0.99 |
Alogp | 2.97 |
Alogp2 | 8.81 |
Apol | 58.6822 |
Bpol | 38.2738 |
EccentricConnectivityIndexDescriptor | 428 |
FmfDescriptor | 0.5385 |
Fsp3 | 0.7 |
FragmentComplexityDescriptor | 2486.06 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1478 |
Xlogp | 2.125 |
ZagrebIndex | 142 |
TopoPSA | 85.36 |