Name | Methyl 2-{6'-ethenyl-2-hydroxy-3',5',6',7',8',8'a-hexahydro-2'h-spiro[indole-3,1'-indolizin]-7'-yl}-3-methoxyprop-2-enoate |
Wikidata | Q105172754 |
Mol. formula | C22H26N2O4 |
CAS registry number | - |
Mol. weight | 382.4537 |
Temporary LOTUS id | LTS0034184 |
Name | Methyl 2-{6'-ethenyl-2-hydroxy-3',5',6',7',8',8'a-hexahydro-2'h-spiro[indole-3,1'-indolizin]-7'-yl}-3-methoxyprop-2-enoate |
Canonical SMILES | C=CC1CN2CCC3(C(O)=Nc4ccccc43)C2CC1C(=COC)C(=O)OC |
2D SMILES | C=CC1CN2CCC3(C(O)=Nc4ccccc43)C2CC1C(=COC)C(=O)OC |
IUPAC name | methyl 2-{6'-ethenyl-2-hydroxy-3',5',6',7',8',8'a-hexahydro-2'H-spiro[indole-3,1'-indolizin]-7'-yl}-3-methoxyprop-2-enoate |
InChI | InChI=1S/C22H26N2O4/c1-4-14-12-24-10-9-22(17-7-5-6-8-18(17)23-21(22)26)19(24)11-15(14)16(13-27-2)20(25)28-3/h4-8,13-15,19H,1,9-12H2,2-3H3,(H,23,26) |
InChIKey | MUVGVMUWMAGNSY-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | N1=CC2(c3ccccc13)CCN4CCCCC42 |
Pathway | Superclass | Class |
Alkaloids | Tryptophan alkaloids | Corynanthe type |
Total atom number | 54 |
Heavy atom number | 28 |
Bond count | 31 |
Number of carbons | 22 |
Minimal number of rings | 4 |
Maximal number of rings | 6 |
NP-likeness score | 0.98 |
Alogp | 1.84 |
Alogp2 | 3.38 |
Apol | 61.4646 |
Bpol | 36.5134 |
EccentricConnectivityIndexDescriptor | 521 |
FmfDescriptor | 0.6071 |
Fsp3 | 0.4545 |
FragmentComplexityDescriptor | 2493.06 |
PetitjeanNumber | 0.4545 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1808 |
Xlogp | 2.391 |
ZagrebIndex | 154 |
TopoPSA | 71.36 |