Name | (8r,9e)-8-hydroxypentadec-9-en-11,13-diyn-2-one |
Wikidata | Q105160916 |
Mol. formula | C15H20O2 |
CAS registry number | - |
Mol. weight | 232.3187 |
Temporary LOTUS id | LTS0034007 |
Name | (8r,9e)-8-hydroxypentadec-9-en-11,13-diyn-2-one |
Canonical SMILES | CC#CC#C/C=C/[C@H](O)CCCCCC(C)=O |
2D SMILES | CC#CC#CC=CC(O)CCCCCC(C)=O |
IUPAC name | (8R,9E)-8-hydroxypentadec-9-en-11,13-diyn-2-one |
InChI | InChI=1S/C15H20O2/c1-3-4-5-6-9-12-15(17)13-10-7-8-11-14(2)16/h9,12,15,17H,7-8,10-11,13H2,1-2H3/b12-9+/t15-/m0/s1 |
InChIKey | MBQRYCZVORMEPE-RZXPCSSPSA-N |
Deep SMILES | could not be computed |
Murcko Framework | not applicable |
Pathway | Superclass | Class |
Fatty acids | Fatty acyls | Fatty alcohols |
Total atom number | 37 |
Heavy atom number | 17 |
Bond count | 16 |
Number of carbons | 15 |
Minimal number of rings | 0 |
Maximal number of rings | 0 |
NP-likeness score | 1.03 |
Alogp | 3.25 |
Alogp2 | 10.57 |
Apol | 41.3399 |
Bpol | 22.8221 |
EccentricConnectivityIndexDescriptor | 336 |
FmfDescriptor | 0 |
Fsp3 | 0.5333 |
FragmentComplexityDescriptor | 1024.02 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 746 |
Xlogp | 3.181 |
ZagrebIndex | 66 |
TopoPSA | 37.3 |