Name | 2-{[6-hydroxy-3,4-bis(4-hydroxy-3-methoxyphenyl)hexyl]oxy}-5-(hydroxymethyl)oxolane-3,4-diol |
Wikidata | Q105001079 |
Mol. formula | C25H34O10 |
CAS registry number | - |
Mol. weight | 494.5324 |
Temporary LOTUS id | LTS0032491 |
Name | 2-{[6-hydroxy-3,4-bis(4-hydroxy-3-methoxyphenyl)hexyl]oxy}-5-(hydroxymethyl)oxolane-3,4-diol |
Canonical SMILES | COc1cc(C(CCO)C(CCOC2OC(CO)C(O)C2O)c2ccc(O)c(OC)c2)ccc1O |
2D SMILES | COc1cc(C(CCO)C(CCOC2OC(CO)C(O)C2O)c2ccc(O)c(OC)c2)ccc1O |
IUPAC name | 2-{[6-hydroxy-3,4-bis(4-hydroxy-3-methoxyphenyl)hexyl]oxy}-5-(hydroxymethyl)oxolane-3,4-diol |
InChI | InChI=1S/C25H34O10/c1-32-20-11-14(3-5-18(20)28)16(7-9-26)17(15-4-6-19(29)21(12-15)33-2)8-10-34-25-24(31)23(30)22(13-27)35-25/h3-6,11-12,16-17,22-31H,7-10,13H2,1-2H3 |
InChIKey | FTJGHGYLEJFODG-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | c1ccc(cc1)CCc2ccccc2 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids|Shikimates and Phenylpropanoids | Lignans|Lignans | Neolignans| |
Total atom number | 69 |
Heavy atom number | 35 |
Bond count | 37 |
Number of carbons | 25 |
Minimal number of rings | 3 |
Maximal number of rings | 3 |
NP-likeness score | 1 |
Alogp | 1.42 |
Alogp2 | 2.02 |
Apol | 74.691 |
Bpol | 44.833 |
EccentricConnectivityIndexDescriptor | 810 |
FmfDescriptor | 0.6286 |
Fsp3 | 0.52 |
FragmentComplexityDescriptor | 3851.1 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 2 |
WienerPathNumber | 3738 |
Xlogp | 0.869 |
ZagrebIndex | 176 |
TopoPSA | 158.3 |