Name | 1-[3-(3,7-dimethylocta-2,6-dien-1-yl)-2,4,6-trihydroxyphenyl]-2-methylpropan-1-one |
Wikidata | Q105266381 |
Mol. formula | C20H28O4 |
CAS registry number | - |
Mol. weight | 332.4347 |
Temporary LOTUS id | LTS0029074 |
Name | 1-[3-(3,7-dimethylocta-2,6-dien-1-yl)-2,4,6-trihydroxyphenyl]-2-methylpropan-1-one |
Canonical SMILES | CC(C)=CCCC(C)=CCc1c(O)cc(O)c(C(=O)C(C)C)c1O |
2D SMILES | CC(C)=CCCC(C)=CCc1c(O)cc(O)c(C(=O)C(C)C)c1O |
IUPAC name | 1-[3-(3,7-dimethylocta-2,6-dien-1-yl)-2,4,6-trihydroxyphenyl]-2-methylpropan-1-one |
InChI | InChI=1S/C20H28O4/c1-12(2)7-6-8-14(5)9-10-15-16(21)11-17(22)18(20(15)24)19(23)13(3)4/h7,9,11,13,21-22,24H,6,8,10H2,1-5H3 |
InChIKey | TXDNBNXWWCEVMG-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | c1ccccc1 |
Pathway | Superclass | Class |
Polyketides | Phloroglucinols | Prenylated,geranylated phloroglucinols |
Total atom number | 52 |
Heavy atom number | 24 |
Bond count | 24 |
Number of carbons | 20 |
Minimal number of rings | 1 |
Maximal number of rings | 1 |
NP-likeness score | 1.02 |
Alogp | 5.58 |
Alogp2 | 31.14 |
Apol | 57.0782 |
Bpol | 31.5678 |
EccentricConnectivityIndexDescriptor | 483 |
FmfDescriptor | 0.25 |
Fsp3 | 0.45 |
FragmentComplexityDescriptor | 2152.04 |
PetitjeanNumber | 0.4615 |
LipinskiRuleOf5Failures | 1 |
WienerPathNumber | 1484 |
Xlogp | 5.575 |
ZagrebIndex | 114 |
TopoPSA | 77.76 |