Name | 1,1,7,7a-tetramethyl-1ah,2h,3h,5h,6h,7h,7bh-cyclopropa[a]naphthalene-3,5-diol |
Wikidata | Q105377924 |
Mol. formula | C15H24O2 |
CAS registry number | - |
Mol. weight | 236.3504 |
Temporary LOTUS id | LTS0028636 |
Name | 1,1,7,7a-tetramethyl-1ah,2h,3h,5h,6h,7h,7bh-cyclopropa[a]naphthalene-3,5-diol |
Canonical SMILES | CC1CC(O)C=C2C(O)CC3C(C3(C)C)C21C |
2D SMILES | CC1CC(O)C=C2C(O)CC3C(C3(C)C)C21C |
IUPAC name | 1,1,7,7a-tetramethyl-1H,1aH,2H,3H,5H,6H,7H,7aH,7bH-cyclopropa[a]naphthalene-3,5-diol |
InChI | InChI=1S/C15H24O2/c1-8-5-9(16)6-10-12(17)7-11-13(14(11,2)3)15(8,10)4/h6,8-9,11-13,16-17H,5,7H2,1-4H3 |
InChIKey | ZJIVEFDADFTLMI-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | C1=C2CCC3CC3C2CCC1 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Aristolane sesquiterpenoids |
Total atom number | 41 |
Heavy atom number | 17 |
Bond count | 19 |
Number of carbons | 15 |
Minimal number of rings | 3 |
Maximal number of rings | 6 |
NP-likeness score | 1 |
Alogp | 1.92 |
Alogp2 | 3.68 |
Apol | 44.007 |
Bpol | 26.237 |
EccentricConnectivityIndexDescriptor | 193 |
FmfDescriptor | 0.6471 |
Fsp3 | 0.8667 |
FragmentComplexityDescriptor | 1577.02 |
PetitjeanNumber | 0.4286 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 426 |
Xlogp | 2.871 |
ZagrebIndex | 104 |
TopoPSA | 40.46 |