Name | 4,5-dihydroxy-6,6,9a-trimethyl-3h,4h,5h,5ah,7h,8h,9h-naphtho[1,2-c]furan-1-one |
Wikidata | Q105008832 |
Mol. formula | C15H22O4 |
CAS registry number | - |
Mol. weight | 266.3334 |
Temporary LOTUS id | LTS0027283 |
Name | 4,5-dihydroxy-6,6,9a-trimethyl-3h,4h,5h,5ah,7h,8h,9h-naphtho[1,2-c]furan-1-one |
Canonical SMILES | CC1(C)CCCC2(C)C3=C(COC3=O)C(O)C(O)C12 |
2D SMILES | CC1(C)CCCC2(C)C3=C(COC3=O)C(O)C(O)C12 |
IUPAC name | 4,5-dihydroxy-6,6,9a-trimethyl-1H,3H,4H,5H,5aH,6H,7H,8H,9H,9aH-naphtho[1,2-c]furan-1-one |
InChI | InChI=1S/C15H22O4/c1-14(2)5-4-6-15(3)9-8(7-19-13(9)18)10(16)11(17)12(14)15/h10-12,16-17H,4-7H2,1-3H3 |
InChIKey | GIAMLDHPAMQJAT-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1CC2=C(C1)C3CCCCC3CC2 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Drimane sesquiterpenoids |
Total atom number | 41 |
Heavy atom number | 19 |
Bond count | 21 |
Number of carbons | 15 |
Minimal number of rings | 3 |
Maximal number of rings | 6 |
NP-likeness score | 1.27 |
Alogp | 1.53 |
Alogp2 | 2.34 |
Apol | 44.2774 |
Bpol | 26.9246 |
EccentricConnectivityIndexDescriptor | 213 |
FmfDescriptor | 0.6842 |
Fsp3 | 0.8 |
FragmentComplexityDescriptor | 1507.04 |
PetitjeanNumber | 0.3333 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 556 |
Xlogp | 2.266 |
ZagrebIndex | 112 |
TopoPSA | 66.76 |