Name | (3s,4s)-3,4-bis[(7-methoxy-2h-1,3-benzodioxol-5-yl)methyl]oxolan-2-one |
Wikidata | Q105257419 |
Mol. formula | C22H22O8 |
CAS registry number | - |
Mol. weight | 414.4061 |
Temporary LOTUS id | LTS0027132 |
Name | (3s,4s)-3,4-bis[(7-methoxy-2h-1,3-benzodioxol-5-yl)methyl]oxolan-2-one |
Canonical SMILES | COc1cc(C[C@@H]2COC(=O)[C@H]2Cc2cc(OC)c3c(c2)OCO3)cc2c1OCO2 |
2D SMILES | COc1cc(CC2COC(=O)C2Cc2cc(OC)c3c(c2)OCO3)cc2c1OCO2 |
IUPAC name | (3S,4S)-3,4-bis[(7-methoxy-2H-1,3-benzodioxol-5-yl)methyl]oxolan-2-one |
InChI | InChI=1S/C22H22O8/c1-24-16-5-12(7-18-20(16)29-10-27-18)3-14-9-26-22(23)15(14)4-13-6-17(25-2)21-19(8-13)28-11-30-21/h5-8,14-15H,3-4,9-11H2,1-2H3/t14-,15+/m1/s1 |
InChIKey | SPICWNPCROOQRU-CABCVRRESA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1c2ccc(cc2OC1)CC3COCC3Cc4ccc5OCOc5c4 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Lignans | Dibenzylbutyrolactone lignans |
Total atom number | 52 |
Heavy atom number | 30 |
Bond count | 34 |
Number of carbons | 22 |
Minimal number of rings | 5 |
Maximal number of rings | 7 |
NP-likeness score | 1.01 |
Alogp | 3.54 |
Alogp2 | 12.52 |
Apol | 59.8054 |
Bpol | 38.4206 |
EccentricConnectivityIndexDescriptor | 703 |
FmfDescriptor | 0.8333 |
Fsp3 | 0.4091 |
FragmentComplexityDescriptor | 2266.08 |
PetitjeanNumber | 0.4615 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 2532 |
Xlogp | 2.775 |
ZagrebIndex | 166 |
TopoPSA | 81.68 |