Name | 1-{3-[(3-amino-3-carboxy-2-hydroxypropyl)amino]-3-carboxypropyl}azetidine-2-carboxylic acid |
Wikidata | Q104910045 |
Mol. formula | C12H21N3O7 |
CAS registry number | - |
Mol. weight | 319.3115 |
Temporary LOTUS id | LTS0026206 |
Name | 1-{3-[(3-amino-3-carboxy-2-hydroxypropyl)amino]-3-carboxypropyl}azetidine-2-carboxylic acid |
Canonical SMILES | NC(C(=O)O)C(O)CNC(CCN1CCC1C(=O)O)C(=O)O |
2D SMILES | NC(C(=O)O)C(O)CNC(CCN1CCC1C(=O)O)C(=O)O |
IUPAC name | 1-{3-[(3-amino-3-carboxy-2-hydroxypropyl)amino]-3-carboxypropyl}azetidine-2-carboxylic acid |
InChI | InChI=1S/C12H21N3O7/c13-9(12(21)22)8(16)5-14-6(10(17)18)1-3-15-4-2-7(15)11(19)20/h6-9,14,16H,1-5,13H2,(H,17,18)(H,19,20)(H,21,22) |
InChIKey | AEFGUQJJQWSYJR-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | N1CCC1 |
Pathway | Superclass | Class |
Amino acids and Peptides | Small peptides | Aminoacids |
Total atom number | 43 |
Heavy atom number | 22 |
Bond count | 22 |
Number of carbons | 12 |
Minimal number of rings | 1 |
Maximal number of rings | 1 |
NP-likeness score | 1.82 |
Alogp | -2.38 |
Alogp2 | 5.66 |
Apol | 44.0367 |
Bpol | 27.8113 |
EccentricConnectivityIndexDescriptor | 406 |
FmfDescriptor | 0.1818 |
Fsp3 | 0.75 |
FragmentComplexityDescriptor | 1387.1 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 1 |
WienerPathNumber | 1217 |
Xlogp | -4.976 |
ZagrebIndex | 104 |
TopoPSA | 173.42 |