Name | [(2r,3s,4s,5r,6r)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl (2e)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
Wikidata | Q105157931 |
Mol. formula | C16H20O9 |
CAS registry number | - |
Mol. weight | 356.3252 |
Temporary LOTUS id | LTS0026036 |
Name | [(2r,3s,4s,5r,6r)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl (2e)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
Canonical SMILES | COc1cc(/C=C/C(=O)OC[C@H]2O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O)ccc1O |
2D SMILES | COc1cc(C=CC(=O)OCC2OC(O)C(O)C(O)C2O)ccc1O |
IUPAC name | [(2R,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl (2E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
InChI | InChI=1S/C16H20O9/c1-23-10-6-8(2-4-9(10)17)3-5-12(18)24-7-11-13(19)14(20)15(21)16(22)25-11/h2-6,11,13-17,19-22H,7H2,1H3/b5-3+/t11-,13-,14+,15-,16-/m1/s1 |
InChIKey | LVNFIOGAAUPIPC-BJGSYIFTSA-N |
Deep SMILES | could not be computed |
Murcko Framework | c1ccccc1 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Phenylpropanoids (C6-C3) | Cinnamic acids and derivatives |
Total atom number | 45 |
Heavy atom number | 25 |
Bond count | 26 |
Number of carbons | 16 |
Minimal number of rings | 2 |
Maximal number of rings | 2 |
NP-likeness score | 1.01 |
Alogp | -0.29 |
Alogp2 | 0.08 |
Apol | 48.7139 |
Bpol | 28.5701 |
EccentricConnectivityIndexDescriptor | 572 |
FmfDescriptor | 0.68 |
Fsp3 | 0.4375 |
FragmentComplexityDescriptor | 1516.09 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1762 |
Xlogp | -0.156 |
ZagrebIndex | 124 |
TopoPSA | 145.91 |