Name | [(4r)-4-[(2r)-2-hydroxy-6-methylhept-5-en-2-yl]cyclohex-1-en-1-yl]methyl furan-2-carboxylate |
Wikidata | Q105255926 |
Mol. formula | C20H28O4 |
CAS registry number | - |
Mol. weight | 332.4347 |
Temporary LOTUS id | LTS0025705 |
Name | [(4r)-4-[(2r)-2-hydroxy-6-methylhept-5-en-2-yl]cyclohex-1-en-1-yl]methyl furan-2-carboxylate |
Canonical SMILES | CC(C)=CCC[C@@](C)(O)[C@H]1CC=C(COC(=O)c2ccco2)CC1 |
2D SMILES | CC(C)=CCCC(C)(O)C1CC=C(COC(=O)c2ccco2)CC1 |
IUPAC name | [(4R)-4-[(2R)-2-hydroxy-6-methylhept-5-en-2-yl]cyclohex-1-en-1-yl]methyl furan-2-carboxylate |
InChI | InChI=1S/C20H28O4/c1-15(2)6-4-12-20(3,22)17-10-8-16(9-11-17)14-24-19(21)18-7-5-13-23-18/h5-8,13,17,22H,4,9-12,14H2,1-3H3/t17-,20+/m0/s1 |
InChIKey | SMHIKDBMNREKKM-FXAWDEMLSA-N |
Deep SMILES | could not be computed |
Murcko Framework | o1cccc1COCC2=CCCCC2 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Bisabolane sesquiterpenoids |
Total atom number | 52 |
Heavy atom number | 24 |
Bond count | 25 |
Number of carbons | 20 |
Minimal number of rings | 2 |
Maximal number of rings | 2 |
NP-likeness score | 1.28 |
Alogp | 4.66 |
Alogp2 | 21.69 |
Apol | 57.0782 |
Bpol | 35.3998 |
EccentricConnectivityIndexDescriptor | 570 |
FmfDescriptor | 0.5833 |
Fsp3 | 0.55 |
FragmentComplexityDescriptor | 2257.04 |
PetitjeanNumber | 0.4667 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1634 |
Xlogp | 3.361 |
ZagrebIndex | 118 |
TopoPSA | 59.67 |