Temporary LOTUS id | LTS0023479 |
Name | Quinizarin |
Canonical SMILES | O=C1c2ccccc2C(=O)c2c(O)ccc(O)c21 |
2D SMILES | O=C1c2ccccc2C(=O)c2c(O)ccc(O)c21 |
IUPAC name | 1,4-dihydroxy-9,10-dihydroanthracene-9,10-dione |
InChI | InChI=1S/C14H8O4/c15-9-5-6-10(16)12-11(9)13(17)7-3-1-2-4-8(7)14(12)18/h1-6,15-16H |
InChIKey | GUEIZVNYDFNHJU-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | c1ccc2c(c1)Cc3ccccc3C2 |
Pathway | Superclass | Class |
Polyketides | Polycyclic aromatic polyketides | Anthraquinones and anthrones |
Total atom number | 26 |
Heavy atom number | 18 |
Bond count | 20 |
Number of carbons | 14 |
Minimal number of rings | 3 |
Maximal number of rings | 6 |
NP-likeness score | 1.05 |
Alogp | 2.27 |
Alogp2 | 5.17 |
Apol | 33.1823 |
Bpol | 10.6617 |
EccentricConnectivityIndexDescriptor | 224 |
FmfDescriptor | 0.7778 |
Fsp3 | 0 |
FragmentComplexityDescriptor | 478.04 |
PetitjeanNumber | 0.4286 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 511 |
Xlogp | 2.296 |
ZagrebIndex | 100 |
TopoPSA | 74.6 |