Name | 4-hydroxy-4-(3-hydroxybut-1-en-1-yl)-3,3,5-trimethylcyclohexan-1-one |
Wikidata | Q82730350 |
Mol. formula | C13H22O3 |
CAS registry number | - |
Mol. weight | 226.3125 |
Temporary LOTUS id | LTS0023393 |
Name | 4-hydroxy-4-(3-hydroxybut-1-en-1-yl)-3,3,5-trimethylcyclohexan-1-one |
Canonical SMILES | CC(O)C=CC1(O)C(C)CC(=O)CC1(C)C |
2D SMILES | CC(O)C=CC1(O)C(C)CC(=O)CC1(C)C |
IUPAC name | 4-hydroxy-4-(3-hydroxybut-1-en-1-yl)-3,3,5-trimethylcyclohexan-1-one |
InChI | InChI=1S/C13H22O3/c1-9-7-11(15)8-12(3,4)13(9,16)6-5-10(2)14/h5-6,9-10,14,16H,7-8H2,1-4H3 |
InChIKey | IHDJYDVWNNFPHR-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | C1CCCCC1 |
Pathway | Superclass | Class |
Terpenoids | Apocarotenoids | Apocarotenoids (β-) |
Total atom number | 38 |
Heavy atom number | 16 |
Bond count | 16 |
Number of carbons | 13 |
Minimal number of rings | 1 |
Maximal number of rings | 1 |
NP-likeness score | 1.44 |
Alogp | 1.01 |
Alogp2 | 1.02 |
Apol | 39.9554 |
Bpol | 25.0086 |
EccentricConnectivityIndexDescriptor | 186 |
FmfDescriptor | 0.375 |
Fsp3 | 0.7692 |
FragmentComplexityDescriptor | 1204.03 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 410 |
Xlogp | 0.838 |
ZagrebIndex | 82 |
TopoPSA | 57.53 |