Name | 4-(3-methylbut-2-en-1-yl)-6-[(2e)-3-phenylprop-2-en-1-yl]benzene-1,3-diol |
Wikidata | Q104403053 |
Mol. formula | C20H22O2 |
CAS registry number | - |
Mol. weight | 294.3882 |
Temporary LOTUS id | LTS0023387 |
Name | 4-(3-methylbut-2-en-1-yl)-6-[(2e)-3-phenylprop-2-en-1-yl]benzene-1,3-diol |
Canonical SMILES | CC(C)=CCc1cc(C/C=C/c2ccccc2)c(O)cc1O |
2D SMILES | CC(C)=CCc1cc(CC=Cc2ccccc2)c(O)cc1O |
IUPAC name | 4-(3-methylbut-2-en-1-yl)-6-[(2E)-3-phenylprop-2-en-1-yl]benzene-1,3-diol |
InChI | InChI=1S/C20H22O2/c1-15(2)11-12-18-13-17(19(21)14-20(18)22)10-6-9-16-7-4-3-5-8-16/h3-9,11,13-14,21-22H,10,12H2,1-2H3/b9-6+ |
InChIKey | RCSFMPXDKAMTJI-RMKNXTFCSA-N |
Deep SMILES | could not be computed |
Murcko Framework | c1ccc(cc1)C=CCc2ccccc2 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Phenylpropanoids (C6-C3) | Cinnamoyl phenols |
Total atom number | 44 |
Heavy atom number | 22 |
Bond count | 23 |
Number of carbons | 20 |
Minimal number of rings | 2 |
Maximal number of rings | 2 |
NP-likeness score | 1 |
Alogp | 5.59 |
Alogp2 | 31.3 |
Apol | 51.4734 |
Bpol | 24.0506 |
EccentricConnectivityIndexDescriptor | 456 |
FmfDescriptor | 0.6818 |
Fsp3 | 0.2 |
FragmentComplexityDescriptor | 1563.02 |
PetitjeanNumber | 0.4615 |
LipinskiRuleOf5Failures | 1 |
WienerPathNumber | 1218 |
Xlogp | 5.657 |
ZagrebIndex | 106 |
TopoPSA | 40.46 |