Name | (9r)-6,8-dihydroxy-2,2,4,4-tetramethyl-5-(3-methylbutanoyl)-9-(2-methylpropyl)-9h-xanthene-1,3-dione |
Wikidata | Q105193578 |
Mol. formula | C26H34O6 |
CAS registry number | - |
Mol. weight | 442.5455 |
Temporary LOTUS id | LTS0022716 |
Name | (9r)-6,8-dihydroxy-2,2,4,4-tetramethyl-5-(3-methylbutanoyl)-9-(2-methylpropyl)-9h-xanthene-1,3-dione |
Canonical SMILES | CC(C)CC(=O)c1c(O)cc(O)c2c1OC1=C(C(=O)C(C)(C)C(=O)C1(C)C)[C@@H]2CC(C)C |
2D SMILES | CC(C)CC(=O)c1c(O)cc(O)c2c1OC1=C(C(=O)C(C)(C)C(=O)C1(C)C)C2CC(C)C |
IUPAC name | (9R)-6,8-dihydroxy-2,2,4,4-tetramethyl-5-(3-methylbutanoyl)-9-(2-methylpropyl)-2,3,4,9-tetrahydro-1H-xanthene-1,3-dione |
InChI | InChI=1S/C26H34O6/c1-12(2)9-14-18-16(28)11-17(29)20(15(27)10-13(3)4)21(18)32-23-19(14)22(30)25(5,6)24(31)26(23,7)8/h11-14,28-29H,9-10H2,1-8H3/t14-/m1/s1 |
InChIKey | OKIQBSRHXBDWPA-CQSZACIVSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1c2ccccc2CC3=C1CCCC3 |
Pathway | Superclass | Class |
Polyketides | Phloroglucinols | Dimeric phloroglucinols |
Total atom number | 66 |
Heavy atom number | 32 |
Bond count | 34 |
Number of carbons | 26 |
Minimal number of rings | 3 |
Maximal number of rings | 6 |
NP-likeness score | 1.15 |
Alogp | 5.13 |
Alogp2 | 26.36 |
Apol | 73.243 |
Bpol | 41.959 |
EccentricConnectivityIndexDescriptor | 565 |
FmfDescriptor | 0.4375 |
Fsp3 | 0.5769 |
FragmentComplexityDescriptor | 3632.06 |
PetitjeanNumber | 0.4545 |
LipinskiRuleOf5Failures | 1 |
WienerPathNumber | 2436 |
Xlogp | 5.438 |
ZagrebIndex | 178 |
TopoPSA | 100.9 |