Name | 5-[(1s,3ar,4s,6ar)-4-(3,4-dimethoxyphenyl)-hexahydrofuro[3,4-c]furan-1-yl]-4-methyl-2h-1,3-benzodioxole |
Wikidata | Q103815904 |
Mol. formula | C22H24O6 |
CAS registry number | - |
Mol. weight | 384.4232 |
Temporary LOTUS id | LTS0022513 |
Name | 5-[(1s,3ar,4s,6ar)-4-(3,4-dimethoxyphenyl)-hexahydrofuro[3,4-c]furan-1-yl]-4-methyl-2h-1,3-benzodioxole |
Canonical SMILES | COc1ccc([C@H]2OC[C@@H]3[C@@H](c4ccc5c(c4C)OCO5)OC[C@H]23)cc1OC |
2D SMILES | COc1ccc(C2OCC3C(c4ccc5c(c4C)OCO5)OCC23)cc1OC |
IUPAC name | 5-[(1S,3aR,4S,6aR)-4-(3,4-dimethoxyphenyl)-hexahydrofuro[3,4-c]furan-1-yl]-4-methyl-2H-1,3-benzodioxole |
InChI | InChI=1S/C22H24O6/c1-12-14(5-7-18-20(12)28-11-27-18)22-16-10-25-21(15(16)9-26-22)13-4-6-17(23-2)19(8-13)24-3/h4-8,15-16,21-22H,9-11H2,1-3H3/t15-,16-,21+,22+/m0/s1 |
InChIKey | MPPQCCFNXBGKFC-RZTYQLBFSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1c2ccc(cc2OC1)C3OCC4C(OCC34)c5ccccc5 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Lignans | Furofuranoid lignans |
Total atom number | 52 |
Heavy atom number | 28 |
Bond count | 32 |
Number of carbons | 22 |
Minimal number of rings | 5 |
Maximal number of rings | 7 |
NP-likeness score | 1 |
Alogp | 2.92 |
Alogp2 | 8.54 |
Apol | 59.535 |
Bpol | 37.733 |
EccentricConnectivityIndexDescriptor | 675 |
FmfDescriptor | 0.8214 |
Fsp3 | 0.4545 |
FragmentComplexityDescriptor | 2380.06 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 2063 |
Xlogp | 3.045 |
ZagrebIndex | 158 |
TopoPSA | 55.38 |