Name | 14,15-dimethoxy-10-azatetracyclo[7.6.1.0²,⁷.0¹²,¹⁶]hexadeca-1(16),2(7),3,5,8,10,12,14-octaene-6,11-diol |
Wikidata | Q105146421 |
Mol. formula | C17H13NO4 |
CAS registry number | - |
Mol. weight | 295.2901 |
Temporary LOTUS id | LTS0021720 |
Name | 14,15-dimethoxy-10-azatetracyclo[7.6.1.0²,⁷.0¹²,¹⁶]hexadeca-1(16),2(7),3,5,8,10,12,14-octaene-6,11-diol |
Canonical SMILES | COc1cc2c3c(cc4c(O)cccc4c3c1OC)N=C2O |
2D SMILES | COc1cc2c3c(cc4c(O)cccc4c3c1OC)N=C2O |
IUPAC name | 14,15-dimethoxy-10-azatetracyclo[7.6.1.0²,⁷.0¹²,¹⁶]hexadeca-1(16),2(7),3,5,8,10,12,14-octaene-6,11-diol |
InChI | InChI=1S/C17H13NO4/c1-21-13-7-10-14-11(18-17(10)20)6-9-8(4-3-5-12(9)19)15(14)16(13)22-2/h3-7,19H,1-2H3,(H,18,20) |
InChIKey | KUZNZVMKXPBYIB-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | N1=Cc2cccc3c4ccccc4cc1c23 |
Pathway | Superclass | Class |
Alkaloids|Shikimates and Phenylpropanoids | Tyrosine alkaloids|Phenanthrenoids | Aporphine alkaloids|Phenanthrenes |
Total atom number | 35 |
Heavy atom number | 22 |
Bond count | 25 |
Number of carbons | 17 |
Minimal number of rings | 4 |
Maximal number of rings | 12 |
NP-likeness score | 1 |
Alogp | 2.61 |
Alogp2 | 6.83 |
Apol | 42.8963 |
Bpol | 19.3637 |
EccentricConnectivityIndexDescriptor | 306 |
FmfDescriptor | 0.7273 |
Fsp3 | 0.1176 |
FragmentComplexityDescriptor | 982.05 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 870 |
Xlogp | 2.961 |
ZagrebIndex | 126 |
TopoPSA | 71.28 |