Name | (3r,4s)-7-methoxy-3-(4-methoxyphenyl)-3,4-dihydro-2h-1-benzopyran-4,6-diol |
Wikidata | Q105202436 |
Mol. formula | C17H18O5 |
CAS registry number | - |
Mol. weight | 302.3225 |
Temporary LOTUS id | LTS0019996 |
Name | (3r,4s)-7-methoxy-3-(4-methoxyphenyl)-3,4-dihydro-2h-1-benzopyran-4,6-diol |
Canonical SMILES | COc1ccc([C@@H]2COc3cc(OC)c(O)cc3[C@H]2O)cc1 |
2D SMILES | COc1ccc(C2COc3cc(OC)c(O)cc3C2O)cc1 |
IUPAC name | (3R,4S)-7-methoxy-3-(4-methoxyphenyl)-3,4-dihydro-2H-1-benzopyran-4,6-diol |
InChI | InChI=1S/C17H18O5/c1-20-11-5-3-10(4-6-11)13-9-22-15-8-16(21-2)14(18)7-12(15)17(13)19/h3-8,13,17-19H,9H2,1-2H3/t13-,17+/m0/s1 |
InChIKey | OWZQLGWYJGXUMM-SUMWQHHRSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1c2ccccc2CC(c3ccccc3)C1 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids|Shikimates and Phenylpropanoids | Flavonoids|Flavonoids | |Flavandiols (Leucoanthocyanidins) |
Total atom number | 40 |
Heavy atom number | 22 |
Bond count | 24 |
Number of carbons | 17 |
Minimal number of rings | 3 |
Maximal number of rings | 4 |
NP-likeness score | 1 |
Alogp | 2.3 |
Alogp2 | 5.29 |
Apol | 45.9323 |
Bpol | 25.4257 |
EccentricConnectivityIndexDescriptor | 450 |
FmfDescriptor | 0.7273 |
Fsp3 | 0.2941 |
FragmentComplexityDescriptor | 1302.05 |
PetitjeanNumber | 0.4615 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1069 |
Xlogp | 1.913 |
ZagrebIndex | 116 |
TopoPSA | 68.15 |