Name | Quinovic acid |
Wikidata | Q27272637 |
Mol. formula | C30H46O5 |
CAS registry number | - |
Mol. weight | 486.6844 |
Temporary LOTUS id | LTS0019469 |
Name | Quinovic acid |
Canonical SMILES | C[C@@H]1[C@H]2C3=CC[C@@H]4[C@@]5(C)CC[C@H](O)C(C)(C)[C@@H]5CC[C@@]4(C)[C@]3(C(=O)O)CC[C@@]2(C(=O)O)CC[C@H]1C |
2D SMILES | CC1CCC2(C(=O)O)CCC3(C(=O)O)C(=CCC4C5(C)CCC(O)C(C)(C)C5CCC43C)C2C1C |
IUPAC name | (1S,2R,4aS,6aR,6bR,8aR,10S,12aR,12bR,14bS)-10-hydroxy-1,2,6b,9,9,12a-hexamethyl-1,2,3,4,4a,5,6,6a,6b,7,8,8a,9,10,11,12,12a,12b,13,14b-icosahydropicene-4a,6a-dicarboxylic acid |
InChI | InChI=1S/C30H46O5/c1-17-9-14-29(24(32)33)15-16-30(25(34)35)19(23(29)18(17)2)7-8-21-27(5)12-11-22(31)26(3,4)20(27)10-13-28(21,30)6/h7,17-18,20-23,31H,8-16H2,1-6H3,(H,32,33)(H,34,35)/t17-,18+,20+,21-,22+,23+,27+,28-,29+,30-/m1/s1 |
InChIKey | OJUYFGQEMPENCE-DPKHZRJYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | C1=C2C3CCCCC3CCC2C4CCC5CCCCC5C4C1 |
Pathway | Superclass | Class |
Terpenoids | Triterpenoids | Ursane and Taraxastane triterpenoids |
Total atom number | 81 |
Heavy atom number | 35 |
Bond count | 39 |
Number of carbons | 30 |
Minimal number of rings | 5 |
Maximal number of rings | 14 |
NP-likeness score | 1.34 |
Alogp | 5.59 |
Alogp2 | 31.2 |
Apol | 87.4825 |
Bpol | 52.2035 |
EccentricConnectivityIndexDescriptor | 705 |
FmfDescriptor | 0.6286 |
Fsp3 | 0.8667 |
FragmentComplexityDescriptor | 6035.05 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 1 |
WienerPathNumber | 2994 |
Xlogp | 7.277 |
ZagrebIndex | 212 |
TopoPSA | 94.83 |