Name | (4r,4as,7ar,8r)-4,8-dihydroxy-6,6,8-trimethyl-3h,4h,4ah,5h,7h,7ah,9h-azuleno[5,6-c]furan-1-one |
Wikidata | Q105279692 |
Mol. formula | C15H22O4 |
CAS registry number | - |
Mol. weight | 266.3334 |
Temporary LOTUS id | LTS0019406 |
Name | (4r,4as,7ar,8r)-4,8-dihydroxy-6,6,8-trimethyl-3h,4h,4ah,5h,7h,7ah,9h-azuleno[5,6-c]furan-1-one |
Canonical SMILES | CC1(C)C[C@@H]2[C@@H](O)C3=C(C[C@@](C)(O)[C@@H]2C1)C(=O)OC3 |
2D SMILES | CC1(C)CC2C(O)C3=C(CC(C)(O)C2C1)C(=O)OC3 |
IUPAC name | (4R,4aS,7aR,8R)-4,8-dihydroxy-6,6,8-trimethyl-1H,3H,4H,4aH,5H,6H,7H,7aH,8H,9H-azuleno[5,6-c]furan-1-one |
InChI | InChI=1S/C15H22O4/c1-14(2)4-9-11(6-14)15(3,18)5-8-10(12(9)16)7-19-13(8)17/h9,11-12,16,18H,4-7H2,1-3H3/t9-,11+,12+,15+/m0/s1 |
InChIKey | UUZWMJQAEYBHAO-AYIJCJCZSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1CC2=C(C1)CC3CCCC3CC2 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Lactarane sesquiterpenoids |
Total atom number | 41 |
Heavy atom number | 19 |
Bond count | 21 |
Number of carbons | 15 |
Minimal number of rings | 3 |
Maximal number of rings | 6 |
NP-likeness score | 1.32 |
Alogp | 1.33 |
Alogp2 | 1.76 |
Apol | 44.2774 |
Bpol | 26.9246 |
EccentricConnectivityIndexDescriptor | 239 |
FmfDescriptor | 0.6842 |
Fsp3 | 0.8 |
FragmentComplexityDescriptor | 1507.04 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 584 |
Xlogp | 1.424 |
ZagrebIndex | 112 |
TopoPSA | 66.76 |