Name | 2-(2-phenylethyl)benzoic acid |
Wikidata | Q72443356 |
Mol. formula | C15H14O2 |
CAS registry number | - |
Mol. weight | 226.271 |
Temporary LOTUS id | LTS0019316 |
Name | 2-(2-phenylethyl)benzoic acid |
Canonical SMILES | O=C(O)c1ccccc1CCc1ccccc1 |
2D SMILES | O=C(O)c1ccccc1CCc1ccccc1 |
IUPAC name | 2-(2-phenylethyl)benzoic acid |
InChI | InChI=1S/C15H14O2/c16-15(17)14-9-5-4-8-13(14)11-10-12-6-2-1-3-7-12/h1-9H,10-11H2,(H,16,17) |
InChIKey | IOHPVZBSOKLVMN-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | c1ccc(cc1)CCc2ccccc2 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Stilbenoids | Monomeric stilbenes |
Total atom number | 31 |
Heavy atom number | 17 |
Bond count | 18 |
Number of carbons | 15 |
Minimal number of rings | 2 |
Maximal number of rings | 2 |
NP-likeness score | 1.35 |
Alogp | 3.87 |
Alogp2 | 14.94 |
Apol | 37.3391 |
Bpol | 16.2629 |
EccentricConnectivityIndexDescriptor | 261 |
FmfDescriptor | 0.8235 |
Fsp3 | 0.1333 |
FragmentComplexityDescriptor | 752.02 |
PetitjeanNumber | 0.4444 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 558 |
Xlogp | 3.983 |
ZagrebIndex | 82 |
TopoPSA | 37.3 |