Name | 7-methoxy-2-phenyl-3-(prop-1-en-2-yl)-1,2,3,4-tetrahydronaphthalene-1,5-diol |
Wikidata | Q105191894 |
Mol. formula | C20H22O3 |
CAS registry number | - |
Mol. weight | 310.3876 |
Temporary LOTUS id | LTS0018544 |
Name | 7-methoxy-2-phenyl-3-(prop-1-en-2-yl)-1,2,3,4-tetrahydronaphthalene-1,5-diol |
Canonical SMILES | C=C(C)C1Cc2c(O)cc(OC)cc2C(O)C1c1ccccc1 |
2D SMILES | C=C(C)C1Cc2c(O)cc(OC)cc2C(O)C1c1ccccc1 |
IUPAC name | 7-methoxy-2-phenyl-3-(prop-1-en-2-yl)-1,2,3,4-tetrahydronaphthalene-1,5-diol |
InChI | InChI=1S/C20H22O3/c1-12(2)15-11-16-17(9-14(23-3)10-18(16)21)20(22)19(15)13-7-5-4-6-8-13/h4-10,15,19-22H,1,11H2,2-3H3 |
InChIKey | OGWAQMQGHCSXMO-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | c1ccc(cc1)C2Cc3ccccc3CC2 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Stilbenoids | Monomeric stilbenes |
Total atom number | 45 |
Heavy atom number | 23 |
Bond count | 25 |
Number of carbons | 20 |
Minimal number of rings | 3 |
Maximal number of rings | 4 |
NP-likeness score | 1 |
Alogp | 4.07 |
Alogp2 | 16.59 |
Apol | 52.2754 |
Bpol | 25.9666 |
EccentricConnectivityIndexDescriptor | 379 |
FmfDescriptor | 0.6957 |
Fsp3 | 0.3 |
FragmentComplexityDescriptor | 1703.03 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1074 |
Xlogp | 3.534 |
ZagrebIndex | 122 |
TopoPSA | 49.69 |