Name | (-)-tylocrebrine |
Wikidata | Q27105249 |
Mol. formula | C24H27NO4 |
CAS registry number | - |
Mol. weight | 393.4764 |
Temporary LOTUS id | LTS0017265 |
Name | (-)-tylocrebrine |
Canonical SMILES | COc1cc2c3c(c4ccc(OC)c(OC)c4c2cc1OC)CN1CCC[C@H]1C3 |
2D SMILES | COc1cc2c3c(c4ccc(OC)c(OC)c4c2cc1OC)CN1CCCC1C3 |
IUPAC name | (20S)-4,5,9,10-tetramethoxy-16-azapentacyclo[12.7.0.0²,⁷.0⁸,¹³.0¹⁶,²⁰]henicosa-1(14),2(7),3,5,8(13),9,11-heptaene |
InChI | InChI=1S/C24H27NO4/c1-26-20-8-7-15-19-13-25-9-5-6-14(25)10-16(19)17-11-21(27-2)22(28-3)12-18(17)23(15)24(20)29-4/h7-8,11-12,14H,5-6,9-10,13H2,1-4H3/t14-/m0/s1 |
InChIKey | YFEPHJVWLFGWKH-AWEZNQCLSA-N |
Deep SMILES | could not be computed |
Murcko Framework | c1ccc2c(c1)c3ccccc3c4c2CN5CCCC5C4 |
Pathway | Superclass | Class |
Alkaloids | Lysine alkaloids | Indolizidine alkaloids |
Total atom number | 56 |
Heavy atom number | 29 |
Bond count | 33 |
Number of carbons | 24 |
Minimal number of rings | 5 |
Maximal number of rings | 16 |
NP-likeness score | 1 |
Alogp | 4.22 |
Alogp2 | 17.8 |
Apol | 64.5514 |
Bpol | 39.1606 |
EccentricConnectivityIndexDescriptor | 527 |
FmfDescriptor | 0.7241 |
Fsp3 | 0.4167 |
FragmentComplexityDescriptor | 2788.05 |
PetitjeanNumber | 0.4 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1903 |
Xlogp | 4.086 |
ZagrebIndex | 164 |
TopoPSA | 40.16 |